3-chloro-2-(4-chloro-2-fluoro-5-(prop-2-ynyloxy)phenyl)-4,5,6,7-tetrahydro-2H-indazole

ID: ALA2286884

PubChem CID: 13373356

Max Phase: Preclinical

Molecular Formula: C16H13Cl2FN2O

Molecular Weight: 339.20

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C#CCOc1cc(-n2nc3c(c2Cl)CCCC3)c(F)cc1Cl

Standard InChI:  InChI=1S/C16H13Cl2FN2O/c1-2-7-22-15-9-14(12(19)8-11(15)17)21-16(18)10-5-3-4-6-13(10)20-21/h1,8-9H,3-7H2

Standard InChI Key:  SKHORAKBOXLMHT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
    0.9864   -6.8925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9864   -7.7097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6917   -8.1141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6917   -6.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3970   -6.8925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4015   -7.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1810   -7.9592    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6583   -7.2946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1737   -6.6354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4722   -7.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8841   -7.9974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7005   -7.9932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1060   -7.2827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6891   -6.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8740   -6.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4219   -5.8568    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.4596   -5.8784    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.9232   -7.2771    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.1127   -8.6989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9299   -8.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3421   -9.4003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7427  -10.1035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
  9 16  1  0
 15 17  1  0
 13 18  1  0
 12 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  3  0
M  END

Associated Targets(non-human)

Protoporphyrinogen IX oxidase (122 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 339.20Molecular Weight (Monoisotopic): 338.0389AlogP: 4.21#Rotatable Bonds: 3
Polar Surface Area: 27.05Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.75CX LogP: 4.52CX LogD: 4.52
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.78Np Likeness Score: -1.83

References

1. ISHIDA S, HIRAI K, KOHNO H, SATO Y, KUBO H, BOGER P, WAKABAYASHI K.  (1997)  Protoporphyrinogen-IX Oxidase Inhibition by N-(2, 4, 5-Trisubstituted phenyl)-3, 4, 5, 6-tetrahydrophthalimides,  22  (4): [10.1584/jpestics.22.299]

Source