The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3R)-3-hydroxy-N-(3-methoxy-4-(pent-2-ynyloxy)phenethyl)-2-(methylsulfonamido)butanamide ID: ALA2287020
PubChem CID: 76323790
Max Phase: Preclinical
Molecular Formula: C19H28N2O6S
Molecular Weight: 412.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC#CCOc1ccc(CCNC(=O)[C@@H](NS(C)(=O)=O)[C@@H](C)O)cc1OC
Standard InChI: InChI=1S/C19H28N2O6S/c1-5-6-7-12-27-16-9-8-15(13-17(16)26-3)10-11-20-19(23)18(14(2)22)21-28(4,24)25/h8-9,13-14,18,21-22H,5,10-12H2,1-4H3,(H,20,23)/t14-,18+/m1/s1
Standard InChI Key: WLRHPVZVBDFUMA-KDOFPFPSSA-N
Molfile:
RDKit 2D
28 28 0 0 0 0 0 0 0 0999 V2000
1.8323 -8.4323 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5468 -8.0198 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1178 -8.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4156 -9.1448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2406 -9.1448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2612 -8.4323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9757 -8.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2612 -9.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6902 -8.4323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9757 -7.1948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4046 -8.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1191 -8.4323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8336 -8.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5469 -8.4364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2609 -8.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2614 -7.1987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5419 -6.7863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8308 -7.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9752 -8.4374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9748 -9.2624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9753 -6.7852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6903 -7.1968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4042 -6.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1156 -6.3656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8281 -5.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5449 -6.3575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5468 -9.6698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9757 -9.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
1 5 2 0
6 2 1 6
6 7 1 0
6 8 1 0
7 9 1 0
7 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
15 19 1 0
19 20 1 0
16 21 1 0
21 22 1 0
22 23 1 0
23 24 3 0
24 25 1 0
25 26 1 0
8 27 1 1
8 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.51Molecular Weight (Monoisotopic): 412.1668AlogP: 0.44#Rotatable Bonds: 10Polar Surface Area: 113.96Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.65CX Basic pKa: ┄CX LogP: 0.73CX LogD: 0.71Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.48Np Likeness Score: -0.50