(2S,3R)-3-hydroxy-N-(3-methoxy-4-(pent-2-ynyloxy)phenethyl)-2-(methylsulfonamido)butanamide

ID: ALA2287020

PubChem CID: 76323790

Max Phase: Preclinical

Molecular Formula: C19H28N2O6S

Molecular Weight: 412.51

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC#CCOc1ccc(CCNC(=O)[C@@H](NS(C)(=O)=O)[C@@H](C)O)cc1OC

Standard InChI:  InChI=1S/C19H28N2O6S/c1-5-6-7-12-27-16-9-8-15(13-17(16)26-3)10-11-20-19(23)18(14(2)22)21-28(4,24)25/h8-9,13-14,18,21-22H,5,10-12H2,1-4H3,(H,20,23)/t14-,18+/m1/s1

Standard InChI Key:  WLRHPVZVBDFUMA-KDOFPFPSSA-N

Molfile:  

     RDKit          2D

 28 28  0  0  0  0  0  0  0  0999 V2000
    1.8323   -8.4323    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5468   -8.0198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1178   -8.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4156   -9.1448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2406   -9.1448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2612   -8.4323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9757   -8.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2612   -9.2573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6902   -8.4323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9757   -7.1948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4046   -8.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1191   -8.4323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8336   -8.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5469   -8.4364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2609   -8.0245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2614   -7.1987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5419   -6.7863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8308   -7.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9752   -8.4374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9748   -9.2624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9753   -6.7852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6903   -7.1968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4042   -6.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1156   -6.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8281   -5.9490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5449   -6.3575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5468   -9.6698    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9757   -9.6698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  1  5  2  0
  6  2  1  6
  6  7  1  0
  6  8  1  0
  7  9  1  0
  7 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 15 19  1  0
 19 20  1  0
 16 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  3  0
 24 25  1  0
 25 26  1  0
  8 27  1  1
  8 28  1  0
M  END

Associated Targets(non-human)

Plasmopara viticola (181 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Phytophthora infestans (820 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.51Molecular Weight (Monoisotopic): 412.1668AlogP: 0.44#Rotatable Bonds: 10
Polar Surface Area: 113.96Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.65CX Basic pKa: CX LogP: 0.73CX LogD: 0.71
Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.48Np Likeness Score: -0.50

References

1. Lamberth C.  (2010)  Amino acid chemistry in crop protection,  66  (36): [10.1016/j.tet.2010.06.008]

Source