The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-5-(3-methoxy-4-(pent-2-ynyloxy)phenethylamino)-4-(methylsulfonamido)-5-oxopentanoic acid ID: ALA2287021
PubChem CID: 11419310
Max Phase: Preclinical
Molecular Formula: C20H28N2O7S
Molecular Weight: 440.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC#CCOc1ccc(CCNC(=O)[C@H](CCC(=O)O)NS(C)(=O)=O)cc1OC
Standard InChI: InChI=1S/C20H28N2O7S/c1-4-5-6-13-29-17-9-7-15(14-18(17)28-2)11-12-21-20(25)16(8-10-19(23)24)22-30(3,26)27/h7,9,14,16,22H,4,8,10-13H2,1-3H3,(H,21,25)(H,23,24)/t16-/m0/s1
Standard InChI Key: WDPCEEYEKATBOM-INIZCTEOSA-N
Molfile:
RDKit 2D
30 30 0 0 0 0 0 0 0 0999 V2000
16.8391 -23.3147 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.5468 -22.9061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1314 -22.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4264 -24.0205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2436 -24.0205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2545 -23.3147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9622 -22.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2545 -24.1319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6699 -23.3147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9622 -22.0889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3776 -22.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0853 -23.3147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7931 -22.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4997 -23.3187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2069 -22.9108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2073 -22.0928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4946 -21.6843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7903 -22.0946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9144 -23.3198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9140 -24.1370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9145 -21.6832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6227 -22.0909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3299 -21.6813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0346 -21.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7403 -20.8549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4503 -21.2595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9622 -24.5405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9622 -25.3577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2545 -25.7663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6699 -25.7663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
1 5 2 0
2 6 1 0
6 7 1 0
6 8 1 6
7 9 1 0
7 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
15 19 1 0
19 20 1 0
16 21 1 0
21 22 1 0
22 23 1 0
23 24 3 0
24 25 1 0
25 26 1 0
8 27 1 0
27 28 1 0
28 29 2 0
28 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 440.52Molecular Weight (Monoisotopic): 440.1617AlogP: 0.93#Rotatable Bonds: 12Polar Surface Area: 131.03Molecular Species: ACIDHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.81CX Basic pKa: ┄CX LogP: 1.01CX LogD: -2.25Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.41Np Likeness Score: -0.37