The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(3-methoxy-4-(pent-2-ynyloxy)phenethyl)-2-(methylsulfonamido)-4-(methylthio)butanamide ID: ALA2287022
PubChem CID: 11154955
Max Phase: Preclinical
Molecular Formula: C20H30N2O5S2
Molecular Weight: 442.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC#CCOc1ccc(CCNC(=O)[C@H](CCSC)NS(C)(=O)=O)cc1OC
Standard InChI: InChI=1S/C20H30N2O5S2/c1-5-6-7-13-27-18-9-8-16(15-19(18)26-2)10-12-21-20(23)17(11-14-28-3)22-29(4,24)25/h8-9,15,17,22H,5,10-14H2,1-4H3,(H,21,23)/t17-/m0/s1
Standard InChI Key: OCSNZRRQYGTMPG-KRWDZBQOSA-N
Molfile:
RDKit 2D
29 29 0 0 0 0 0 0 0 0999 V2000
1.6509 -29.1341 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.3586 -28.7255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9432 -28.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2382 -29.8399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0554 -29.8399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0663 -29.1341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7740 -28.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0663 -29.9513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4817 -29.1341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7740 -27.9083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 -28.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8971 -29.1341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6048 -28.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3115 -29.1381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0187 -28.7302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0191 -27.9122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3064 -27.5037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6021 -27.9140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7262 -29.1392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7258 -29.9564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7263 -27.5026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4345 -27.9103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1417 -27.5007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8464 -27.0870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5521 -26.6743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2621 -27.0789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7740 -30.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7740 -31.1771 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.0663 -31.5857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
1 5 2 0
2 6 1 0
6 7 1 0
6 8 1 6
7 9 1 0
7 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
15 19 1 0
19 20 1 0
16 21 1 0
21 22 1 0
22 23 1 0
23 24 3 0
24 25 1 0
25 26 1 0
8 27 1 0
27 28 1 0
28 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.60Molecular Weight (Monoisotopic): 442.1596AlogP: 1.82#Rotatable Bonds: 12Polar Surface Area: 93.73Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.74CX Basic pKa: ┄CX LogP: 2.01CX LogD: 2.01Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.48Np Likeness Score: -0.86