(S)-N-(3-methoxy-4-(pent-2-ynyloxy)phenethyl)-2-(methylsulfonamido)-4-(methylthio)butanamide

ID: ALA2287022

PubChem CID: 11154955

Max Phase: Preclinical

Molecular Formula: C20H30N2O5S2

Molecular Weight: 442.60

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC#CCOc1ccc(CCNC(=O)[C@H](CCSC)NS(C)(=O)=O)cc1OC

Standard InChI:  InChI=1S/C20H30N2O5S2/c1-5-6-7-13-27-18-9-8-16(15-19(18)26-2)10-12-21-20(23)17(11-14-28-3)22-29(4,24)25/h8-9,15,17,22H,5,10-14H2,1-4H3,(H,21,23)/t17-/m0/s1

Standard InChI Key:  OCSNZRRQYGTMPG-KRWDZBQOSA-N

Molfile:  

     RDKit          2D

 29 29  0  0  0  0  0  0  0  0999 V2000
    1.6509  -29.1341    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.3586  -28.7255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9432  -28.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2382  -29.8399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0554  -29.8399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0663  -29.1341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7740  -28.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0663  -29.9513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4817  -29.1341    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7740  -27.9083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1894  -28.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8971  -29.1341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6048  -28.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3115  -29.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0187  -28.7302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0191  -27.9122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3064  -27.5037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6021  -27.9140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7262  -29.1392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7258  -29.9564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7263  -27.5026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4345  -27.9103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1417  -27.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8464  -27.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5521  -26.6743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2621  -27.0789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7740  -30.3599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7740  -31.1771    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.0663  -31.5857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  1  5  2  0
  2  6  1  0
  6  7  1  0
  6  8  1  6
  7  9  1  0
  7 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 15 19  1  0
 19 20  1  0
 16 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  3  0
 24 25  1  0
 25 26  1  0
  8 27  1  0
 27 28  1  0
 28 29  1  0
M  END

Associated Targets(non-human)

Plasmopara viticola (181 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Phytophthora infestans (820 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.60Molecular Weight (Monoisotopic): 442.1596AlogP: 1.82#Rotatable Bonds: 12
Polar Surface Area: 93.73Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.74CX Basic pKa: CX LogP: 2.01CX LogD: 2.01
Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.48Np Likeness Score: -0.86

References

1. Lamberth C.  (2010)  Amino acid chemistry in crop protection,  66  (36): [10.1016/j.tet.2010.06.008]

Source