The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(3-methoxy-4-(pent-2-ynyloxy)phenethyl)-2-(methylsulfonamido)propanamide ID: ALA2287033
PubChem CID: 11349573
Max Phase: Preclinical
Molecular Formula: C18H26N2O5S
Molecular Weight: 382.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC#CCOc1ccc(CCNC(=O)[C@H](C)NS(C)(=O)=O)cc1OC
Standard InChI: InChI=1S/C18H26N2O5S/c1-5-6-7-12-25-16-9-8-15(13-17(16)24-3)10-11-19-18(21)14(2)20-26(4,22)23/h8-9,13-14,20H,5,10-12H2,1-4H3,(H,19,21)/t14-/m0/s1
Standard InChI Key: XQGRUDHUGGVFEM-AWEZNQCLSA-N
Molfile:
RDKit 2D
26 26 0 0 0 0 0 0 0 0999 V2000
16.7854 -2.9634 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.4931 -2.5548 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0777 -2.5548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3727 -3.6691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1899 -3.6691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2009 -2.9634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9086 -2.5548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2009 -3.7805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6163 -2.9633 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9086 -1.7376 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3240 -2.5548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0317 -2.9633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7394 -2.5548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4460 -2.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1532 -2.5595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1537 -1.7414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4410 -1.3330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7367 -1.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8607 -2.9684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8604 -3.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8608 -1.3319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5691 -1.7395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2763 -1.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9809 -0.9162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6867 -0.5035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3966 -0.9082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
1 5 2 0
2 6 1 0
6 7 1 0
6 8 1 6
7 9 1 0
7 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
15 19 1 0
19 20 1 0
16 21 1 0
21 22 1 0
22 23 1 0
23 24 3 0
24 25 1 0
25 26 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 382.48Molecular Weight (Monoisotopic): 382.1562AlogP: 1.08#Rotatable Bonds: 9Polar Surface Area: 93.73Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.33CX Basic pKa: ┄CX LogP: 1.36CX LogD: 1.36Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.62Np Likeness Score: -0.86