The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R/S)-N-(3-methoxy-4-(pent-2-ynyloxy)phenethyl)-2-(methylsulfonamido)pent-4-enamide ID: ALA2287034
PubChem CID: 11269812
Max Phase: Preclinical
Molecular Formula: C20H28N2O5S
Molecular Weight: 408.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CCC(NS(C)(=O)=O)C(=O)NCCc1ccc(OCC#CCC)c(OC)c1
Standard InChI: InChI=1S/C20H28N2O5S/c1-5-7-8-14-27-18-11-10-16(15-19(18)26-3)12-13-21-20(23)17(9-6-2)22-28(4,24)25/h6,10-11,15,17,22H,2,5,9,12-14H2,1,3-4H3,(H,21,23)
Standard InChI Key: FDJAWPOSXPLEAR-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 28 0 0 0 0 0 0 0 0999 V2000
2.9510 -7.7674 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.6587 -7.3588 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2433 -7.3588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5382 -8.4732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3554 -8.4732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3664 -7.7674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0741 -7.3588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3664 -8.5846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7818 -7.7674 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0741 -6.5417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4895 -7.3588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1972 -7.7674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9049 -7.3588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6115 -7.7715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3188 -7.3636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3192 -6.5455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6065 -6.1371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9022 -6.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0263 -7.7725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0259 -8.5897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0264 -6.1360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7346 -6.5436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4418 -6.1341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1464 -5.7203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8522 -5.3076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5622 -5.7123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0741 -8.9932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0741 -9.8104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
1 5 2 0
2 6 1 0
6 7 1 0
6 8 1 0
7 9 1 0
7 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
15 19 1 0
19 20 1 0
16 21 1 0
21 22 1 0
22 23 1 0
23 24 3 0
24 25 1 0
25 26 1 0
8 27 1 0
27 28 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 408.52Molecular Weight (Monoisotopic): 408.1719AlogP: 1.64#Rotatable Bonds: 11Polar Surface Area: 93.73Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.72CX Basic pKa: ┄CX LogP: 2.02CX LogD: 2.02Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.43Np Likeness Score: -0.41