(S)-N-(3-methoxy-4-(pent-2-ynyloxy)phenethyl)-2-(methylsulfonamido)pentanamide

ID: ALA2287035

PubChem CID: 11407234

Max Phase: Preclinical

Molecular Formula: C20H30N2O5S

Molecular Weight: 410.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC#CCOc1ccc(CCNC(=O)[C@H](CCC)NS(C)(=O)=O)cc1OC

Standard InChI:  InChI=1S/C20H30N2O5S/c1-5-7-8-14-27-18-11-10-16(15-19(18)26-3)12-13-21-20(23)17(9-6-2)22-28(4,24)25/h10-11,15,17,22H,5-6,9,12-14H2,1-4H3,(H,21,23)/t17-/m0/s1

Standard InChI Key:  YOKZNYLBRBFZPQ-KRWDZBQOSA-N

Molfile:  

     RDKit          2D

 28 28  0  0  0  0  0  0  0  0999 V2000
   17.2147   -7.0328    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.9224   -6.6242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5070   -6.6242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8019   -7.7386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6191   -7.7386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6301   -7.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3378   -6.6242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6301   -7.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0455   -7.0328    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3378   -5.8070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7532   -6.6242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4609   -7.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1686   -6.6242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8752   -7.0368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5825   -6.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5829   -5.8108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8702   -5.4024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1659   -5.8127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2900   -7.0378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2896   -7.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2901   -5.4013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.9983   -5.8090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7055   -5.3994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4101   -4.9857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1159   -4.5730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8259   -4.9776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3378   -8.2586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3378   -9.0758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  1  5  2  0
  2  6  1  0
  6  7  1  0
  6  8  1  6
  7  9  1  0
  7 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 15 19  1  0
 19 20  1  0
 16 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  3  0
 24 25  1  0
 25 26  1  0
  8 27  1  0
 27 28  1  0
M  END

Associated Targets(non-human)

Plasmopara viticola (181 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Phytophthora infestans (820 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 410.54Molecular Weight (Monoisotopic): 410.1875AlogP: 1.86#Rotatable Bonds: 11
Polar Surface Area: 93.73Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.86CX Basic pKa: CX LogP: 2.33CX LogD: 2.32
Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.54Np Likeness Score: -0.64

References

1. Lamberth C.  (2010)  Amino acid chemistry in crop protection,  66  (36): [10.1016/j.tet.2010.06.008]

Source