(2S,3S)-N-(3-methoxy-4-(pent-2-ynyloxy)phenethyl)-3-methyl-2-(methylsulfonamido)pentanamide

ID: ALA2287037

PubChem CID: 76334603

Max Phase: Preclinical

Molecular Formula: C21H32N2O5S

Molecular Weight: 424.56

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC#CCOc1ccc(CCNC(=O)[C@@H](NS(C)(=O)=O)[C@@H](C)CC)cc1OC

Standard InChI:  InChI=1S/C21H32N2O5S/c1-6-8-9-14-28-18-11-10-17(15-19(18)27-4)12-13-22-21(24)20(16(3)7-2)23-29(5,25)26/h10-11,15-16,20,23H,6-7,12-14H2,1-5H3,(H,22,24)/t16-,20-/m0/s1

Standard InChI Key:  LKYLXLUQVZCTOA-JXFKEZNVSA-N

Molfile:  

     RDKit          2D

 29 29  0  0  0  0  0  0  0  0999 V2000
    2.0385   -8.6592    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.7530   -8.2467    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3241   -8.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6219   -9.3717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4469   -9.3717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4675   -8.6592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1819   -8.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4675   -9.4842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8964   -8.6592    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1819   -7.4217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6109   -8.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3254   -8.6592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0398   -8.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7532   -8.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4672   -8.2514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4676   -7.4255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7481   -7.0132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0371   -7.4274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1814   -8.6643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1811   -9.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1815   -7.0121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8966   -7.4236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6105   -7.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3219   -6.5925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0344   -6.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7511   -6.5843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7530   -9.8967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1819   -9.8967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1819  -10.7217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  1  5  2  0
  6  2  1  6
  6  7  1  0
  6  8  1  0
  7  9  1  0
  7 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 15 19  1  0
 19 20  1  0
 16 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  3  0
 24 25  1  0
 25 26  1  0
  8 27  1  6
  8 28  1  0
 28 29  1  0
M  END

Associated Targets(non-human)

Plasmopara viticola (181 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Phytophthora infestans (820 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 424.56Molecular Weight (Monoisotopic): 424.2032AlogP: 2.11#Rotatable Bonds: 11
Polar Surface Area: 93.73Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.59CX Basic pKa: CX LogP: 2.69CX LogD: 2.69
Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.53Np Likeness Score: -0.57

References

1. Lamberth C.  (2010)  Amino acid chemistry in crop protection,  66  (36): [10.1016/j.tet.2010.06.008]

Source