flumipropyn

ID: ALA2287110

Cas Number: 84478-52-4

PubChem CID: 158434

Max Phase: Preclinical

Molecular Formula: C18H15ClFNO3

Molecular Weight: 347.77

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C#CC(C)Oc1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1Cl

Standard InChI:  InChI=1S/C18H15ClFNO3/c1-3-10(2)24-16-9-15(14(20)8-13(16)19)21-17(22)11-6-4-5-7-12(11)18(21)23/h1,8-10H,4-7H2,2H3

Standard InChI Key:  ONNQFZOZHDEENE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   11.6966   -2.2287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6966   -3.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4018   -3.4504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4018   -1.8160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1071   -2.2287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1071   -3.0469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8852   -3.2998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3663   -2.6379    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8853   -1.9760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1379   -1.1988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1377   -4.0770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1825   -2.6377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5904   -3.3471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4069   -3.3474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8163   -2.6392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4033   -1.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5882   -1.9323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1777   -1.2257    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.6335   -2.6381    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   16.8151   -4.0553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6323   -4.0557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0406   -4.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0413   -3.3482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4446   -2.6373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  9 10  2  0
  7 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  8 12  1  0
 17 18  1  0
 15 19  1  0
 14 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  3  0
M  END

Alternative Forms

  1. Parent:

    ALA2287110

    FLUMIPROPYN

Associated Targets(non-human)

Scenedesmus acutus (534 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Protoporphyrinogen IX oxidase (122 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 347.77Molecular Weight (Monoisotopic): 347.0724AlogP: 3.62#Rotatable Bonds: 3
Polar Surface Area: 46.61Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.00CX LogP: 3.70CX LogD: 3.70
Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.62Np Likeness Score: -0.63

References

1. ISHIDA S, HIRAI K, KOHNO H, SATO Y, KUBO H, BOGER P, WAKABAYASHI K.  (1997)  Protoporphyrinogen-IX Oxidase Inhibition by N-(2, 4, 5-Trisubstituted phenyl)-3, 4, 5, 6-tetrahydrophthalimides,  22  (4): [10.1584/jpestics.22.299]

Source