(-)-gloeosporone

ID: ALA2287141

PubChem CID: 14131513

Max Phase: Preclinical

Molecular Formula: C18H30O4

Molecular Weight: 310.43

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCC[C@@H]1CCCCC[C@@H]2CC(=O)[C@H](CCC(=O)O1)O2

Standard InChI:  InChI=1S/C18H30O4/c1-2-3-5-8-14-9-6-4-7-10-15-13-16(19)17(21-15)11-12-18(20)22-14/h14-15,17H,2-13H2,1H3/t14-,15-,17+/m1/s1

Standard InChI Key:  QFWVYEDCHXPQOX-INMHGKMJSA-N

Molfile:  

     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   13.3998   -9.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2248   -9.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4816   -8.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8123   -8.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1473   -8.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3040   -8.6332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7136   -7.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2981   -7.2043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4731   -7.2078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0577   -6.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2327   -6.4984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8173   -5.7856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8231   -7.2145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9981   -7.2179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5887   -7.9341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5827   -6.5052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0041   -8.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9140  -10.0876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2268   -5.0695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0518   -5.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4672   -5.7788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2922   -5.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  6
  3  4  1  0
  5  4  1  6
  5  1  1  0
  3  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  6
 11 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17  5  1  0
  1 18  2  0
 12 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Colletotrichum gloeosporioides (560 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 310.43Molecular Weight (Monoisotopic): 310.2144AlogP: 3.95#Rotatable Bonds: 4
Polar Surface Area: 52.60Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.30CX LogD: 4.30
Aromatic Rings: Heavy Atoms: 22QED Weighted: 0.58Np Likeness Score: 1.60

References

1. UENO T, MIYAGAWA H, TSURUSHIMA T, INOUE M.  (1997)  Spore Germination Self-Inhibitors from Plant Pathogenic Fungi,  22  (4): [10.1584/jpestics.22.342]

Source