(+)-gloeosporone

ID: ALA2287142

PubChem CID: 76323796

Max Phase: Preclinical

Molecular Formula: C18H30O4

Molecular Weight: 310.43

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCC[C@H]1CCCCC[C@H]2CC(=O)[C@@H](CCC(=O)O1)O2

Standard InChI:  InChI=1S/C18H30O4/c1-2-3-5-8-14-9-6-4-7-10-15-13-16(19)17(21-15)11-12-18(20)22-14/h14-15,17H,2-13H2,1H3/t14-,15-,17+/m0/s1

Standard InChI Key:  QFWVYEDCHXPQOX-YQQAZPJKSA-N

Molfile:  

     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   19.6788   -9.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8538   -9.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5971   -9.0908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2663   -8.6040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9314   -9.0908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7747   -9.0873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3651   -8.3712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7806   -7.6584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6055   -7.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0210   -6.9490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8460   -6.9525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2614   -6.2397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2555   -7.6686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0804   -7.6721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4900   -8.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4960   -6.9593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0746   -9.1010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1646  -10.5417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8518   -5.5236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0269   -5.5201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6114   -6.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7865   -6.2295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  6
  3  4  1  0
  5  4  1  6
  5  1  1  0
  3  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  6
 11 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17  5  1  0
  1 18  2  0
 12 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Colletotrichum gloeosporioides (560 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 310.43Molecular Weight (Monoisotopic): 310.2144AlogP: 3.95#Rotatable Bonds: 4
Polar Surface Area: 52.60Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.30CX LogD: 4.30
Aromatic Rings: Heavy Atoms: 22QED Weighted: 0.58Np Likeness Score: 1.60

References

1. UENO T, MIYAGAWA H, TSURUSHIMA T, INOUE M.  (1997)  Spore Germination Self-Inhibitors from Plant Pathogenic Fungi,  22  (4): [10.1584/jpestics.22.342]

Source