(E)-methyl 3-methoxy-2-(2-((2-(2,4,5-trichlorophenylamino)-6-(trifluoromethyl)pyrimidin-4-yloxy)methyl)phenyl)acrylate

ID: ALA2287237

PubChem CID: 76331034

Max Phase: Preclinical

Molecular Formula: C23H17Cl3F3N3O4

Molecular Weight: 562.76

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CO/C=C(/C(=O)OC)c1ccccc1COc1cc(C(F)(F)F)nc(Nc2cc(Cl)c(Cl)cc2Cl)n1

Standard InChI:  InChI=1S/C23H17Cl3F3N3O4/c1-34-11-14(21(33)35-2)13-6-4-3-5-12(13)10-36-20-9-19(23(27,28)29)31-22(32-20)30-18-8-16(25)15(24)7-17(18)26/h3-9,11H,10H2,1-2H3,(H,30,31,32)/b14-11+

Standard InChI Key:  YCVHBBDUUHCJTK-SDNWHVSQSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
    4.3069  -29.6212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3058  -30.4487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0206  -30.8615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7371  -30.4481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7343  -29.6176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0188  -29.2085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5910  -30.8606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8769  -30.4474    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.5903  -31.6856    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.7875  -31.0713    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.0164  -28.3835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3007  -27.9731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3016  -27.1488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5867  -26.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8724  -27.1532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8776  -27.9825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5931  -28.3890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4522  -30.8595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1660  -30.4459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8812  -30.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8778  -31.6807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5921  -32.0920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3069  -31.6783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3030  -30.8491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5881  -30.4415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5826  -29.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2942  -29.1992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8653  -29.2088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1536  -29.6262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4363  -29.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2887  -28.3742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0114  -29.6069    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7232  -29.1895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0157  -26.7358    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.1562  -26.7438    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.1658  -28.3996    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
  6 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  4 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 28 29  1  0
 29 30  1  0
 27 31  2  0
 27 32  1  0
 32 33  1  0
 13 34  1  0
 15 35  1  0
 16 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2287237

   methyl (E)-3-methoxy-2-[2-[[2-(2,4,5-trichloroanilino)-6-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]phenyl]prop-2-enoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 562.76

Molecular Weight (Monoisotopic): 561.0237

AlogP: 6.94

#Rotatable Bonds: 8

Polar Surface Area: 82.57

Molecular Species: NEUTRAL

HBA: 7

HBD: 1

#RO5 Violations: 2

HBA (Lipinski): 7

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 10.56

CX Basic pKa: 0.39

CX LogP: 7.53

CX LogD: 7.53

Aromatic Rings: 3

Heavy Atoms: 36

QED Weighted: 0.14

Np Likeness Score: -0.95

References

1. Chai BS, Liu CL, Li HC, Zhang H, Liu SW, Huang G, Chang JB..  (2011)  The discovery of SYP-10913 and SYP-11277: novel strobilurin acaricides.,  67  (9): [PMID:21452169] [10.1002/ps.2164]

Source

Source(1):

• Scientific Literature