(E)-methyl 2-(2-((2-(2,4-dichloro-3-methylphenylamino)-6-(trifluoromethyl)pyrimidin-4-yloxy)methyl)phenyl)-3-methoxyacrylate

ID: ALA2287238

PubChem CID: 76312923

Max Phase: Preclinical

Molecular Formula: C24H20Cl2F3N3O4

Molecular Weight: 542.34

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CO/C=C(/C(=O)OC)c1ccccc1COc1cc(C(F)(F)F)nc(Nc2ccc(Cl)c(C)c2Cl)n1

Standard InChI:  InChI=1S/C24H20Cl2F3N3O4/c1-13-17(25)8-9-18(21(13)26)30-23-31-19(24(27,28)29)10-20(32-23)36-11-14-6-4-5-7-15(14)16(12-34-2)22(33)35-3/h4-10,12H,11H2,1-3H3,(H,30,31,32)/b16-12+

Standard InChI Key:  YXUHFUPYWCEWNM-FOWTUZBSSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   14.3990  -29.0925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.3978  -29.9199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1127  -30.3328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8291  -29.9194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8263  -29.0889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1109  -28.6797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6830  -30.3318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9688  -29.9188    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.6824  -31.1568    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.8796  -30.5426    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.1085  -27.8547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.3927  -27.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3936  -26.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6787  -26.2098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9645  -26.6244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9696  -27.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6850  -27.8603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5443  -30.3308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2582  -29.9172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9733  -30.3286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9699  -31.1520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6842  -31.5633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3990  -31.1497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3951  -30.3204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6802  -29.9128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6746  -29.0878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3863  -28.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9574  -28.6801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2456  -29.0974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5284  -28.6897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3807  -27.8455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1036  -29.0781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8152  -28.6608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1077  -26.2070    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   12.2482  -26.2150    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   13.6767  -25.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
  6 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  4 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 28 29  1  0
 29 30  1  0
 27 31  2  0
 27 32  1  0
 32 33  1  0
 13 34  1  0
 15 35  1  0
 14 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2287238

   methyl (E)-2-[2-[[2-(2,4-dichloro-3-methylanilino)-6-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 542.34

Molecular Weight (Monoisotopic): 541.0783

AlogP: 6.59

#Rotatable Bonds: 8

Polar Surface Area: 82.57

Molecular Species: NEUTRAL

HBA: 7

HBD: 1

#RO5 Violations: 2

HBA (Lipinski): 7

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 11.00

CX Basic pKa: 0.51

CX LogP: 7.44

CX LogD: 7.44

Aromatic Rings: 3

Heavy Atoms: 36

QED Weighted: 0.20

Np Likeness Score: -0.94

References

1. Chai BS, Liu CL, Li HC, Zhang H, Liu SW, Huang G, Chang JB..  (2011)  The discovery of SYP-10913 and SYP-11277: novel strobilurin acaricides.,  67  (9): [PMID:21452169] [10.1002/ps.2164]

Source

Source(1):

• Scientific Literature