The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((3-chloro-4-(2-chloro-4-(trifluoromethyl)phenoxy)phenyl)(methyl)carbamoyl)-2,6-difluorobenzamide ID: ALA2287673
PubChem CID: 15622597
Max Phase: Preclinical
Molecular Formula: C22H13Cl2F5N2O3
Molecular Weight: 519.25
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C(=O)NC(=O)c1c(F)cccc1F)c1ccc(Oc2ccc(C(F)(F)F)cc2Cl)c(Cl)c1
Standard InChI: InChI=1S/C22H13Cl2F5N2O3/c1-31(21(33)30-20(32)19-15(25)3-2-4-16(19)26)12-6-8-18(14(24)10-12)34-17-7-5-11(9-13(17)23)22(27,28)29/h2-10H,1H3,(H,30,32,33)
Standard InChI Key: LMOHMKCPSMWXEC-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
5.5308 -24.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1179 -25.4141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5209 -26.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3364 -26.1261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7474 -25.4178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3421 -24.7135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1259 -24.0006 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.3023 -25.4070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5947 -25.8158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8887 -25.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1816 -25.8127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1814 -26.6308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8942 -27.0390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5984 -26.6286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4743 -27.0405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7660 -26.6331 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.4757 -27.8577 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.7647 -27.4613 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.8903 -24.5874 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.5646 -25.4193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9719 -26.1277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7891 -26.1292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5620 -26.8347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1964 -26.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0136 -26.8391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7865 -27.5446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4163 -27.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2328 -27.5488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6435 -26.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2317 -26.1305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4167 -26.1322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0054 -25.4260 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.0047 -28.2529 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.9744 -24.7123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
2 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
15 16 1 0
15 17 1 0
15 18 1 0
10 19 1 0
5 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
24 25 1 0
24 26 2 0
25 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 25 1 0
31 32 1 0
27 33 1 0
20 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.25Molecular Weight (Monoisotopic): 518.0223AlogP: 7.07#Rotatable Bonds: 4Polar Surface Area: 58.64Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.93CX Basic pKa: ┄CX LogP: 6.46CX LogD: 6.44Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -1.50
References 1. KOYANAGI T, MORITA M, FUJII Y. (1998) Synthesis and Insecticidal Activity of Alkylated N-Benzoyl-N-Phenylureas and Their Toxicity to Aquatic Invertebrate, 23 (3): [10.1584/jpestics.23.250 ]