The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Flufenoxuron ID: ALA2287680
Cas Number: 101463-69-8
PubChem CID: 91766
Product Number: F109949, Order Now?
Max Phase: Preclinical
Molecular Formula: C21H11ClF6N2O3
Molecular Weight: 488.77
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC(=O)c1c(F)cccc1F)Nc1ccc(Oc2ccc(C(F)(F)F)cc2Cl)cc1F
Standard InChI: InChI=1S/C21H11ClF6N2O3/c22-12-8-10(21(26,27)28)4-7-17(12)33-11-5-6-16(15(25)9-11)29-20(32)30-19(31)18-13(23)2-1-3-14(18)24/h1-9H,(H2,29,30,31,32)
Standard InChI Key: RYLHNOVXKPXDIP-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
5.3538 -5.9356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6415 -5.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9251 -5.9356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2128 -5.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2128 -4.7002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9251 -4.2855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6415 -4.7002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3538 -6.7606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0702 -5.5252 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3538 -4.2856 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.9251 -6.7606 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.7867 -5.9356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7867 -6.7606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5032 -5.5252 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2154 -5.9356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9277 -5.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6399 -5.9356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6399 -6.7606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9277 -7.1752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2154 -6.7606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9277 -4.7002 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.3564 -7.1752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0729 -6.7606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0729 -5.9356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7893 -5.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5016 -5.9356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5016 -6.7606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7893 -7.1752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2180 -5.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9303 -5.9356 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.2180 -4.7002 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.9303 -5.1106 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.3564 -5.5252 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
1 8 2 0
1 9 1 0
7 10 1 0
3 11 1 0
12 13 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
16 21 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
23 28 2 0
22 23 1 0
29 30 1 0
29 31 1 0
29 32 1 0
26 29 1 0
24 33 1 0
18 22 1 0
14 15 1 0
12 14 1 0
9 12 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.77Molecular Weight (Monoisotopic): 488.0362AlogP: 6.53#Rotatable Bonds: 4Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.99CX Basic pKa: ┄CX LogP: 6.13CX LogD: 6.12Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -1.74
References 1. Tohnishi M, Nakao H, Furuya T, Seo A, Kodama H, Tsubata K, Fujioka S, Kodama H, Hirooka T, Nishimatsu T. (2005) Flubendiamide, a Novel Insecticide Highly Active against Lepidopterous Insect Pests, 30 (4): [10.1584/jpestics.30.354 ] 2. KOYANAGI T, MORITA M, FUJII Y. (1998) Synthesis and Insecticidal Activity of Alkylated N-Benzoyl-N-Phenylureas and Their Toxicity to Aquatic Invertebrate, 23 (3): [10.1584/jpestics.23.250 ] 3. PubChem BioAssay data set,