4-butyryl-3-mesityl-1-oxaspiro[4.4]non-3-en-2-one

ID: ALA2287733

PubChem CID: 76309247

Max Phase: Preclinical

Molecular Formula: C21H26O3

Molecular Weight: 326.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCC(=O)C1=C(c2c(C)cc(C)cc2C)C(=O)OC12CCCC2

Standard InChI:  InChI=1S/C21H26O3/c1-5-8-16(22)19-18(17-14(3)11-13(2)12-15(17)4)20(23)24-21(19)9-6-7-10-21/h11-12H,5-10H2,1-4H3

Standard InChI Key:  KSISTUKDXPQPRZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   11.2534  -16.4913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0071  -16.1745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9388  -15.3598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1428  -15.1730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7193  -15.8723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3368  -16.6698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3357  -17.4894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0437  -17.8983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7534  -17.4889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7505  -16.6662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0419  -16.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0395  -15.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6276  -17.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4617  -17.8964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4569  -16.2549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2275  -16.5225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2502  -15.2004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4689  -15.4397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8154  -14.9489    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4647  -17.3046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2479  -18.0896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2818  -17.2943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6992  -17.9968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5164  -17.9866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
 11 12  1  0
  7 13  1  0
  9 14  1  0
 10 15  1  0
 15 16  2  0
 16  5  1  0
  5 17  1  0
 17 18  1  0
 18 15  1  0
 18 19  2  0
 16 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
M  END

Associated Targets(non-human)

Tetranychus cinnabarinus (1124 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Aphis fabae (223 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mythimna separata (3306 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 326.44Molecular Weight (Monoisotopic): 326.1882AlogP: 4.60#Rotatable Bonds: 4
Polar Surface Area: 43.37Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 5.93CX LogD: 5.93
Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.76Np Likeness Score: 0.27

References

1. Zhao JH, Wang ZC, Ji MH, Cheng JL, Zhu GN, Yu CM..  (2012)  Synthesis and bioactivity evaluation of novel spiromesifen derivatives.,  68  (1): [PMID:21997953] [10.1002/ps.2248]

Source