4-(3,3-dimethylbutanoyl)-3-mesityl-1-oxaspiro[4.4]non-3-en-2-one

ID: ALA2287737

PubChem CID: 76334650

Max Phase: Preclinical

Molecular Formula: C23H30O3

Molecular Weight: 354.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(C)c(C2=C(C(=O)CC(C)(C)C)C3(CCCC3)OC2=O)c(C)c1

Standard InChI:  InChI=1S/C23H30O3/c1-14-11-15(2)18(16(3)12-14)19-20(17(24)13-22(4,5)6)23(26-21(19)25)9-7-8-10-23/h11-12H,7-10,13H2,1-6H3

Standard InChI Key:  FYNUIOVGICLBAE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    5.4340  -21.0271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1878  -20.7104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1194  -19.8956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3234  -19.7088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8999  -20.4082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5174  -21.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5163  -22.0252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2243  -22.4342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9340  -22.0247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9311  -21.2021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2225  -20.7968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2201  -19.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8082  -22.4332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6423  -22.4322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375  -20.7907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4081  -21.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4308  -19.7363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6495  -19.9755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9961  -19.4847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6453  -21.8404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4285  -22.6255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4624  -21.8301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8798  -22.5327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6970  -22.5224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4802  -23.2454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2816  -23.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
 11 12  1  0
  7 13  1  0
  9 14  1  0
 10 15  1  0
 15 16  2  0
 16  5  1  0
  5 17  1  0
 17 18  1  0
 18 15  1  0
 18 19  2  0
 16 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  0
 23 26  1  0
M  END

Associated Targets(non-human)

Aphis fabae (223 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Tetranychus cinnabarinus (1124 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mythimna separata (3306 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 354.49Molecular Weight (Monoisotopic): 354.2195AlogP: 5.24#Rotatable Bonds: 3
Polar Surface Area: 43.37Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.52CX LogD: 6.52
Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.70Np Likeness Score: 0.09

References

1. Zhao JH, Wang ZC, Ji MH, Cheng JL, Zhu GN, Yu CM..  (2012)  Synthesis and bioactivity evaluation of novel spiromesifen derivatives.,  68  (1): [PMID:21997953] [10.1002/ps.2248]

Source