The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(+/-)-rel-(1S,3aS,4S,6aR)-4-(2,6-dimethoxyphenoxy)-1-(5-hydroxy-2-methoxyphenyl)hexahydrofuro[3,4-c]furan-3a-ol ID: ALA2288236
PubChem CID: 76334683
Max Phase: Preclinical
Molecular Formula: C21H24O8
Molecular Weight: 404.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(O)cc1[C@H]1OC[C@]2(O)[C@H](Oc3c(OC)cccc3OC)OC[C@H]12
Standard InChI: InChI=1S/C21H24O8/c1-24-15-8-7-12(22)9-13(15)18-14-10-27-20(21(14,23)11-28-18)29-19-16(25-2)5-4-6-17(19)26-3/h4-9,14,18,20,22-23H,10-11H2,1-3H3/t14-,18-,20+,21-/m1/s1
Standard InChI Key: CTHZSAFLAXYHKF-MLCUKSTJSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
24.0765 -16.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0782 -17.0697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7809 -17.4789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4936 -17.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4937 -16.2477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7836 -15.8400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7789 -15.0228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0776 -14.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2041 -17.4759 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2022 -18.2931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1992 -15.8350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1955 -15.0179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7896 -13.7640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5326 -14.5427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6067 -13.7593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8631 -14.5422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6820 -14.5399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9344 -13.7555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2635 -13.2735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2618 -12.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1056 -15.3188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.9778 -12.0495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9796 -11.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2701 -10.8271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5568 -11.2479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5622 -12.0569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8563 -12.4660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.1475 -12.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6833 -10.8269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
4 9 1 0
9 10 1 0
5 11 1 0
12 11 1 6
12 16 1 0
15 13 1 6
13 14 1 0
14 12 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
19 20 1 1
16 21 1 1
20 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 20 1 0
26 27 1 0
27 28 1 0
23 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 404.42Molecular Weight (Monoisotopic): 404.1471AlogP: 2.27#Rotatable Bonds: 6Polar Surface Area: 95.84Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.78CX Basic pKa: ┄CX LogP: 2.06CX LogD: 2.06Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.76Np Likeness Score: 1.48
References 1. YAMAUCHI S, TANIGUCHI E. (1991) Synthesis and Insecticidal Activity of Lignan Analogs. (1)., 55 (12): [10.1271/bbb1961.55.3075 ]