N,N'-(3,3'-(ethane-1,2-diyl)bis(1-((6-chloropyridin-3-yl)methyl)imidazolidin-3-yl-2-ylidene))dinitramide

ID: ALA2288392

PubChem CID: 14673018

Max Phase: Preclinical

Molecular Formula: C20H22Cl2N10O4

Molecular Weight: 537.37

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=[N+]([O-])/N=C1\N(CCN2CCN(Cc3ccc(Cl)nc3)/C2=N\[N+](=O)[O-])CCN1Cc1ccc(Cl)nc1

Standard InChI:  InChI=1S/C20H22Cl2N10O4/c21-17-3-1-15(11-23-17)13-29-9-7-27(19(29)25-31(33)34)5-6-28-8-10-30(20(28)26-32(35)36)14-16-2-4-18(22)24-12-16/h1-4,11-12H,5-10,13-14H2/b25-19-,26-20+

Standard InChI Key:  CVQOTCCIWHDRIJ-GAHATOAQSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    7.9225   -1.8715    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7454   -1.8476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1343   -1.1242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7015   -0.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8757   -0.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4905   -1.1761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6659   -1.2037    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.9590   -1.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4357   -1.7726    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1675   -2.5571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8289   -3.0502    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5023   -2.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2570   -1.7859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3795   -2.8012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1968   -3.6057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8009   -4.1698    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4074   -3.8535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8187   -3.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5281   -4.2964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5179   -5.1214    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8411   -5.5979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0868   -6.3852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9113   -6.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1758   -5.6143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0600   -5.3323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4395   -5.8759    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5976   -6.6883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6560   -5.6135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6729   -7.0989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0841   -7.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6693   -8.5258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0798   -9.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9057   -9.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3194   -8.5239    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9065   -7.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3178   -9.9573    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  3  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  9  1  0
 10 14  2  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 11 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 20  1  0
 21 25  2  0
 25 26  1  0
 26 27  2  0
 26 28  1  0
 22 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 33 36  1  0
M  CHG  4  15   1  17  -1  26   1  28  -1
M  END

Associated Targets(non-human)

Periplaneta americana (513 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 537.37Molecular Weight (Monoisotopic): 536.1203AlogP: 1.81#Rotatable Bonds: 9
Polar Surface Area: 149.74Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 0.15CX LogP: 1.42CX LogD: 1.42
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.26Np Likeness Score: -0.68

References

1. Kagabu S.  (2008)  Pharmacophore of neonicotinoid insecticides,  33  (1): [10.1584/jpestics.R07-05]

Source