The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(3,3'-(ethane-1,2-diyl)bis(1-((6-chloropyridin-3-yl)methyl)imidazolidin-3-yl-2-ylidene))dinitramide ID: ALA2288392
PubChem CID: 14673018
Max Phase: Preclinical
Molecular Formula: C20H22Cl2N10O4
Molecular Weight: 537.37
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=[N+]([O-])/N=C1\N(CCN2CCN(Cc3ccc(Cl)nc3)/C2=N\[N+](=O)[O-])CCN1Cc1ccc(Cl)nc1
Standard InChI: InChI=1S/C20H22Cl2N10O4/c21-17-3-1-15(11-23-17)13-29-9-7-27(19(29)25-31(33)34)5-6-28-8-10-30(20(28)26-32(35)36)14-16-2-4-18(22)24-12-16/h1-4,11-12H,5-10,13-14H2/b25-19-,26-20+
Standard InChI Key: CVQOTCCIWHDRIJ-GAHATOAQSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
7.9225 -1.8715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7454 -1.8476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1343 -1.1242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7015 -0.4223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8757 -0.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4905 -1.1761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6659 -1.2037 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.9590 -1.0992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4357 -1.7726 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1675 -2.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8289 -3.0502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5023 -2.5735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2570 -1.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3795 -2.8012 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1968 -3.6057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8009 -4.1698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4074 -3.8535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8187 -3.8751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5281 -4.2964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5179 -5.1214 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8411 -5.5979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0868 -6.3852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9113 -6.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1758 -5.6143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0600 -5.3323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4395 -5.8759 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5976 -6.6883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6560 -5.6135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6729 -7.0989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0841 -7.8141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6693 -8.5258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0798 -9.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9057 -9.2426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3194 -8.5239 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9065 -7.8120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3178 -9.9573 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
3 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 9 1 0
10 14 2 0
14 15 1 0
15 16 2 0
15 17 1 0
11 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 20 1 0
21 25 2 0
25 26 1 0
26 27 2 0
26 28 1 0
22 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 36 1 0
M CHG 4 15 1 17 -1 26 1 28 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 537.37Molecular Weight (Monoisotopic): 536.1203AlogP: 1.81#Rotatable Bonds: 9Polar Surface Area: 149.74Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 0.15CX LogP: 1.42CX LogD: 1.42Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.26Np Likeness Score: -0.68