N,N'-(3,3'-(octane-1,8-diyl)bis(1-((6-chloropyridin-3-yl)methyl)imidazolidin-3-yl-2-ylidene))dinitramide

ID: ALA2288393

PubChem CID: 20770752

Max Phase: Preclinical

Molecular Formula: C26H34Cl2N10O4

Molecular Weight: 621.53

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=[N+]([O-])/N=C1/N(CCCCCCCCN2CCN(Cc3ccc(Cl)nc3)/C2=N/[N+](=O)[O-])CCN1Cc1ccc(Cl)nc1

Standard InChI:  InChI=1S/C26H34Cl2N10O4/c27-23-9-7-21(17-29-23)19-35-15-13-33(25(35)31-37(39)40)11-5-3-1-2-4-6-12-34-14-16-36(26(34)32-38(41)42)20-22-8-10-24(28)30-18-22/h7-10,17-18H,1-6,11-16,19-20H2/b31-25-,32-26+

Standard InChI Key:  GQNWLGZVGCWAPK-IEPGDLOPSA-N

Molfile:  

     RDKit          2D

 42 45  0  0  0  0  0  0  0  0999 V2000
    7.6445  -27.0808    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9677  -27.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2134  -28.3447    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0380  -28.3553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3024  -27.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1866  -27.2918    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5661  -27.8354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7243  -28.6478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7826  -27.5730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7996  -29.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2107  -29.7736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7960  -30.4853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2064  -31.2001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0323  -31.2021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4460  -30.4833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0331  -29.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4444  -31.9168    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.9517  -20.0924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7746  -20.0684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1635  -19.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7307  -18.6451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9048  -18.6731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5196  -19.3969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6951  -19.4245    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.9882  -19.3201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4649  -19.9934    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1967  -20.7779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8581  -21.2710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5315  -20.7943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2861  -20.0067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4086  -21.0220    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2260  -21.8265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8301  -22.3907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4366  -22.0743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8479  -22.0960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5572  -22.5172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5471  -23.3422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2564  -23.7635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2462  -24.5884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9556  -25.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9454  -25.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6547  -26.2559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  2  6  2  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  3 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 23 24  1  0
 20 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 26  1  0
 27 31  2  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
 28 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42  1  1  0
M  CHG  4   7   1   9  -1  32   1  34  -1
M  END

Associated Targets(non-human)

Periplaneta americana (513 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 621.53Molecular Weight (Monoisotopic): 620.2142AlogP: 4.15#Rotatable Bonds: 15
Polar Surface Area: 149.74Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 0.21CX LogP: 3.78CX LogD: 3.78
Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.12Np Likeness Score: -0.58

References

1. Kagabu S.  (2008)  Pharmacophore of neonicotinoid insecticides,  33  (1): [10.1584/jpestics.R07-05]

Source