The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(3,3'-(octane-1,8-diyl)bis(1-((6-chloropyridin-3-yl)methyl)imidazolidin-3-yl-2-ylidene))dinitramide ID: ALA2288393
PubChem CID: 20770752
Max Phase: Preclinical
Molecular Formula: C26H34Cl2N10O4
Molecular Weight: 621.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=[N+]([O-])/N=C1/N(CCCCCCCCN2CCN(Cc3ccc(Cl)nc3)/C2=N/[N+](=O)[O-])CCN1Cc1ccc(Cl)nc1
Standard InChI: InChI=1S/C26H34Cl2N10O4/c27-23-9-7-21(17-29-23)19-35-15-13-33(25(35)31-37(39)40)11-5-3-1-2-4-6-12-34-14-16-36(26(34)32-38(41)42)20-22-8-10-24(28)30-18-22/h7-10,17-18H,1-6,11-16,19-20H2/b31-25-,32-26+
Standard InChI Key: GQNWLGZVGCWAPK-IEPGDLOPSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
7.6445 -27.0808 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9677 -27.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2134 -28.3447 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0380 -28.3553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3024 -27.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1866 -27.2918 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5661 -27.8354 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7243 -28.6478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7826 -27.5730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7996 -29.0584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2107 -29.7736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7960 -30.4853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2064 -31.2001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0323 -31.2021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4460 -30.4833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0331 -29.7715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4444 -31.9168 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.9517 -20.0924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7746 -20.0684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1635 -19.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7307 -18.6451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9048 -18.6731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5196 -19.3969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6951 -19.4245 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.9882 -19.3201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4649 -19.9934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1967 -20.7779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8581 -21.2710 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5315 -20.7943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2861 -20.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4086 -21.0220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2260 -21.8265 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8301 -22.3907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4366 -22.0743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8479 -22.0960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5572 -22.5172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5471 -23.3422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2564 -23.7635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2462 -24.5884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9556 -25.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9454 -25.8346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6547 -26.2559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
2 6 2 0
6 7 1 0
7 8 2 0
7 9 1 0
3 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
14 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
23 24 1 0
20 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 26 1 0
27 31 2 0
31 32 1 0
32 33 2 0
32 34 1 0
28 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 1 1 0
M CHG 4 7 1 9 -1 32 1 34 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 621.53Molecular Weight (Monoisotopic): 620.2142AlogP: 4.15#Rotatable Bonds: 15Polar Surface Area: 149.74Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 0.21CX LogP: 3.78CX LogD: 3.78Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.12Np Likeness Score: -0.58