The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-2-[(3-Methoxy-4-benzyloxyphenyl)methylene]-4,6-diethoxy-3(2H)-benzofuranone ID: ALA2288395
PubChem CID: 76309292
Max Phase: Preclinical
Molecular Formula: C27H26O6
Molecular Weight: 446.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1cc(OCC)c2c(c1)O/C(=C\c1ccc(OCc3ccccc3)c(OC)c1)C2=O
Standard InChI: InChI=1S/C27H26O6/c1-4-30-20-15-23(31-5-2)26-24(16-20)33-25(27(26)28)14-19-11-12-21(22(13-19)29-3)32-17-18-9-7-6-8-10-18/h6-16H,4-5,17H2,1-3H3/b25-14-
Standard InChI Key: WAUUPCKQZUDMEX-QFEZKATASA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
16.3145 -17.9419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2282 -18.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9819 -19.0980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5339 -18.4849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1214 -17.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3589 -18.4849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7714 -17.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3589 -17.0559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5339 -17.0559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1534 -19.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7714 -16.3414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3589 -15.6270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7714 -14.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7714 -19.1993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5964 -19.1993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0089 -19.9138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5137 -19.1749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7993 -18.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0848 -19.1749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3703 -18.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3703 -17.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0848 -17.5249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7993 -17.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6559 -17.5249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9414 -17.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2269 -17.5249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5124 -17.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7980 -17.5249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7980 -16.6999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5124 -16.2874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2269 -16.6999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6559 -19.1749 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9414 -18.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
1 5 1 0
6 7 1 0
7 8 2 0
8 9 1 0
5 9 2 0
4 6 2 0
3 10 2 0
12 13 1 0
11 12 1 0
8 11 1 0
15 16 1 0
14 15 1 0
6 14 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
18 23 2 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
26 31 2 0
24 25 1 0
21 24 1 0
32 33 1 0
20 32 1 0
17 18 1 0
2 17 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.50Molecular Weight (Monoisotopic): 446.1729AlogP: 5.69#Rotatable Bonds: 9Polar Surface Area: 63.22Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.01CX LogD: 5.01Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.39Np Likeness Score: -0.16
References 1. Zhang M, Xu XH, Cui Y, Xie LG, Kong CH.. (2012) Synthesis and herbicidal potential of substituted aurones., 68 (11): [PMID:22718431 ] [10.1002/ps.3339 ]