The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-2-[(3,5-dimethoxy-4-benzyloxyphenyl)methylene]-4,6-dibenzoyloxy-3(2H)-benzofuranone ID: ALA2288396
PubChem CID: 76331112
Max Phase: Preclinical
Molecular Formula: C38H28O9
Molecular Weight: 628.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C2\Oc3cc(OC(=O)c4ccccc4)cc(OC(=O)c4ccccc4)c3C2=O)cc(OC)c1OCc1ccccc1
Standard InChI: InChI=1S/C38H28O9/c1-42-32-19-25(20-33(43-2)36(32)44-23-24-12-6-3-7-13-24)18-31-35(39)34-29(46-31)21-28(45-37(40)26-14-8-4-9-15-26)22-30(34)47-38(41)27-16-10-5-11-17-27/h3-22H,23H2,1-2H3/b31-18-
Standard InChI Key: NKDGRJNFZYRGMH-MNBJERMJSA-N
Molfile:
RDKit 2D
47 52 0 0 0 0 0 0 0 0999 V2000
13.7639 -18.1728 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6776 -18.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4313 -19.3289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9833 -18.7158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5708 -18.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8083 -18.7158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2208 -18.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8083 -17.2868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9833 -17.2868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6028 -20.1359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2208 -16.5724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8083 -15.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9833 -15.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5708 -16.5724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7458 -16.5724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3333 -15.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7458 -15.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5708 -15.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2208 -15.1434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2208 -19.4303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0458 -19.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4583 -18.7158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0458 -18.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4583 -17.2868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2833 -17.2868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6958 -18.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2833 -18.7158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4583 -20.1447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9631 -19.4058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2487 -18.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5342 -19.4058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8197 -18.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8197 -18.1683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5342 -17.7558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2487 -18.1683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1053 -17.7558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3908 -18.1683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6763 -17.7558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9618 -18.1683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2474 -17.7558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2474 -16.9308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9619 -16.5183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6763 -16.9308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5342 -16.9308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8197 -16.5183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1053 -19.4058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3908 -18.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
1 5 1 0
6 7 1 0
7 8 2 0
8 9 1 0
5 9 2 0
4 6 2 0
3 10 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
13 18 2 0
12 19 2 0
11 12 1 0
8 11 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
21 28 2 0
20 21 1 0
6 20 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
30 35 2 0
37 38 1 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 43 1 0
38 43 2 0
36 37 1 0
33 36 1 0
44 45 1 0
34 44 1 0
46 47 1 0
32 46 1 0
29 30 1 0
2 29 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 628.63Molecular Weight (Monoisotopic): 628.1733AlogP: 7.34#Rotatable Bonds: 10Polar Surface Area: 106.59Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.78CX LogD: 7.78Aromatic Rings: 5Heavy Atoms: 47QED Weighted: 0.09Np Likeness Score: 0.00
References 1. Zhang M, Xu XH, Cui Y, Xie LG, Kong CH.. (2012) Synthesis and herbicidal potential of substituted aurones., 68 (11): [PMID:22718431 ] [10.1002/ps.3339 ]