(Z)-5-Methyl-2-[(4-benzyloxyphenyl)methylene]-4,6-dimethoxy-3(2H)-benzofuranone

ID: ALA2288400

PubChem CID: 76309294

Max Phase: Preclinical

Molecular Formula: C25H22O5

Molecular Weight: 402.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2c(c(OC)c1C)C(=O)/C(=C/c1ccc(OCc3ccccc3)cc1)O2

Standard InChI:  InChI=1S/C25H22O5/c1-16-20(27-2)14-21-23(25(16)28-3)24(26)22(30-21)13-17-9-11-19(12-10-17)29-15-18-7-5-4-6-8-18/h4-14H,15H2,1-3H3/b22-13-

Standard InChI Key:  RZHLYKBMATYUAT-XKZIYDEJSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   15.2916  -16.9295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2054  -17.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9591  -18.0856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5111  -17.4725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0986  -16.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3361  -17.4725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7486  -16.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3361  -16.0435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5111  -16.0435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1306  -18.8925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7486  -15.3291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3361  -14.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7486  -18.1870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5736  -18.1870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4909  -18.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7764  -17.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0620  -18.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3475  -17.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3475  -16.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0620  -16.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7764  -16.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6330  -16.5125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9186  -16.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2041  -16.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4896  -16.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7751  -16.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7751  -15.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4896  -15.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2041  -15.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5736  -16.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  1  5  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  5  9  2  0
  4  6  2  0
  3 10  2  0
 11 12  1  0
  8 11  1  0
 13 14  1  0
  6 13  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 16 21  2  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 24 29  2  0
 22 23  1  0
 19 22  1  0
 15 16  1  0
  2 15  2  0
  7 30  1  0
M  END

Associated Targets(non-human)

Brassica rapa subsp. oleifera (1696 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Echinochloa crus-galli (3685 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 402.45Molecular Weight (Monoisotopic): 402.1467AlogP: 5.21#Rotatable Bonds: 6
Polar Surface Area: 53.99Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.97CX LogD: 4.97
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.53Np Likeness Score: 0.09

References

1. Zhang M, Xu XH, Cui Y, Xie LG, Kong CH..  (2012)  Synthesis and herbicidal potential of substituted aurones.,  68  (11): [PMID:22718431] [10.1002/ps.3339]

Source