The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(N-(4,6-bis(difluoromethoxy)pyrimidin-2-ylcarbamoyl)sulfamoyl)-N,N-dimethylnicotinamide ID: ALA2288492
PubChem CID: 76331118
Max Phase: Preclinical
Molecular Formula: C15H14F4N6O6S
Molecular Weight: 482.37
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)C(=O)c1cccnc1S(=O)(=O)NC(=O)Nc1nc(OC(F)F)cc(OC(F)F)n1
Standard InChI: InChI=1S/C15H14F4N6O6S/c1-25(2)11(26)7-4-3-5-20-10(7)32(28,29)24-15(27)23-14-21-8(30-12(16)17)6-9(22-14)31-13(18)19/h3-6,12-13H,1-2H3,(H2,21,22,23,24,27)
Standard InChI Key: YHCVXSLPIDPVKU-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
2.9737 -24.6403 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.7909 -24.6390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3812 -23.9319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8488 -23.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8476 -24.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5557 -24.6422 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2654 -24.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2625 -23.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5539 -23.0049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9687 -22.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6779 -23.4048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9656 -22.1817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9750 -25.4575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6833 -25.8650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6846 -26.6821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3904 -25.4552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0987 -25.8627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0957 -26.6795 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8032 -27.0869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5112 -26.6771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5073 -25.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7992 -25.4520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2129 -25.4435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8041 -27.9041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3841 -22.9935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3831 -23.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9227 -25.8485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5122 -28.3119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9269 -26.6657 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.6283 -25.4363 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.5131 -29.1291 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.2195 -27.9025 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 3 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 1 0
10 12 2 0
7 1 1 0
1 13 1 0
13 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
21 23 1 0
19 24 1 0
11 25 1 0
11 26 1 0
23 27 1 0
24 28 1 0
27 29 1 0
27 30 1 0
28 31 1 0
28 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.37Molecular Weight (Monoisotopic): 482.0632AlogP: 1.29#Rotatable Bonds: 8Polar Surface Area: 152.71Molecular Species: ACIDHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.98CX Basic pKa: 1.39CX LogP: 2.63CX LogD: 1.70Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.53Np Likeness Score: -1.59
References 1. MURAI S, HAGA T, SAKASHITA N, NAKAMURA Y, HONDA C, HONZAWA S, KIMURA F, TSUJII Y, NISHIYAMA R. (1995) Synthesis and Herbicidal Activity of Sulfonylureas; SL-950 and Its Related Compounds, 20 (4): [10.1584/jpestics.20.453 ]