3-(3-(2,6-dichloro-4-(3,3-dichloroallyloxy)phenoxy)propoxy)-1-methyl-5-o-tolyl-1H-pyrazole

ID: ALA2288633

PubChem CID: 76320247

Max Phase: Preclinical

Molecular Formula: C23H22Cl4N2O3

Molecular Weight: 516.25

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccccc1-c1cc(OCCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)nn1C

Standard InChI:  InChI=1S/C23H22Cl4N2O3/c1-15-6-3-4-7-17(15)20-14-22(28-29(20)2)31-9-5-10-32-23-18(24)12-16(13-19(23)25)30-11-8-21(26)27/h3-4,6-8,12-14H,5,9-11H2,1-2H3

Standard InChI Key:  FNHPQFFXNMFXTF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   -6.5018  -25.1364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1781  -25.8893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3731  -25.9842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8802  -25.3271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2120  -24.5729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0241  -24.4819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0719  -25.4244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6728  -26.1361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8724  -25.9741    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7761  -25.1622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5186  -24.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0597  -24.7606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3601  -25.1761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6521  -24.7745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0598  -25.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7715  -24.7885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4751  -25.2040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4655  -26.0188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1683  -26.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8810  -26.0326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8864  -25.2112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1830  -24.7995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1872  -23.9823    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.7533  -26.4196    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.5852  -26.4472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2963  -26.0447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0005  -26.4593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7117  -26.0567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4159  -26.4713    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.7187  -25.2395    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -4.0099  -26.8793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7231  -23.9154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  7  2  0
  4  7  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 22 23  1  0
 18 24  1  0
 20 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 28 30  1  0
  8 31  1  0
  5 32  1  0
M  END

Associated Targets(non-human)

Plutella xylostella (1838 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 516.25Molecular Weight (Monoisotopic): 514.0385AlogP: 7.25#Rotatable Bonds: 10
Polar Surface Area: 45.51Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 1.05CX LogP: 7.16CX LogD: 7.16
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.27Np Likeness Score: -0.67

References

1. Li M, Liu CL, Zhang J, Wu Q, Hao SL, Song YQ..  (2013)  Design, synthesis and structure-activity relationship of novel insecticidal dichloro-allyloxy-phenol derivatives containing substituted pyrazol-3-ols.,  69  (5): [PMID:23139228] [10.1002/ps.3417]

Source