The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(3-(2,6-dichloro-4-(3,3-dichloroallyloxy)phenoxy)propoxy)-1-methyl-5-o-tolyl-1H-pyrazole ID: ALA2288633
PubChem CID: 76320247
Max Phase: Preclinical
Molecular Formula: C23H22Cl4N2O3
Molecular Weight: 516.25
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1-c1cc(OCCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)nn1C
Standard InChI: InChI=1S/C23H22Cl4N2O3/c1-15-6-3-4-7-17(15)20-14-22(28-29(20)2)31-9-5-10-32-23-18(24)12-16(13-19(23)25)30-11-8-21(26)27/h3-4,6-8,12-14H,5,9-11H2,1-2H3
Standard InChI Key: FNHPQFFXNMFXTF-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
-6.5018 -25.1364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1781 -25.8893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3731 -25.9842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8802 -25.3271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2120 -24.5729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0241 -24.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0719 -25.4244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6728 -26.1361 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8724 -25.9741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7761 -25.1622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5186 -24.8226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0597 -24.7606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3601 -25.1761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6521 -24.7745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0598 -25.1901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7715 -24.7885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4751 -25.2040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4655 -26.0188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1683 -26.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8810 -26.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8864 -25.2112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1830 -24.7995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1872 -23.9823 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.7533 -26.4196 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.5852 -26.4472 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2963 -26.0447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0005 -26.4593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7117 -26.0567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4159 -26.4713 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.7187 -25.2395 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-4.0099 -26.8793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7231 -23.9154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 7 2 0
4 7 1 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
22 23 1 0
18 24 1 0
20 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
28 30 1 0
8 31 1 0
5 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.25Molecular Weight (Monoisotopic): 514.0385AlogP: 7.25#Rotatable Bonds: 10Polar Surface Area: 45.51Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 1.05CX LogP: 7.16CX LogD: 7.16Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.27Np Likeness Score: -0.67
References 1. Li M, Liu CL, Zhang J, Wu Q, Hao SL, Song YQ.. (2013) Design, synthesis and structure-activity relationship of novel insecticidal dichloro-allyloxy-phenol derivatives containing substituted pyrazol-3-ols., 69 (5): [PMID:23139228 ] [10.1002/ps.3417 ]