3-(3-(2,6-dichloro-4-(3,3-dichloroallyloxy)phenoxy)propoxy)-5-(2,4-dimethylphenyl)-1-methyl-1H-pyrazole

ID: ALA2288634

PubChem CID: 76327450

Max Phase: Preclinical

Molecular Formula: C24H24Cl4N2O3

Molecular Weight: 530.28

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2cc(OCCCOc3c(Cl)cc(OCC=C(Cl)Cl)cc3Cl)nn2C)c(C)c1

Standard InChI:  InChI=1S/C24H24Cl4N2O3/c1-15-5-6-18(16(2)11-15)21-14-23(29-30(21)3)32-8-4-9-33-24-19(25)12-17(13-20(24)26)31-10-7-22(27)28/h5-7,11-14H,4,8-10H2,1-3H3

Standard InChI Key:  KVDPXYZRLFCKNR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    9.4156  -24.6782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7440  -25.4312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5486  -25.5261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0380  -24.8690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7094  -24.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8954  -24.0237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8476  -24.9663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2492  -25.6780    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0502  -25.5160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1437  -24.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4004  -24.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8553  -24.3025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5590  -24.7180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2707  -24.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9744  -24.7319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6860  -24.3303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3897  -24.7459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3801  -25.5607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0829  -25.9762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7956  -25.5745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8010  -24.7531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0976  -24.3413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1018  -23.5242    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   16.6679  -25.9615    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   19.4998  -25.9891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2109  -25.5865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9151  -26.0011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6263  -25.5986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3305  -26.0132    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   21.6332  -24.7814    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.9094  -26.4212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1946  -23.4572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6034  -24.5880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  7  2  0
  4  7  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 22 23  1  0
 18 24  1  0
 20 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 28 30  1  0
  8 31  1  0
  5 32  1  0
  1 33  1  0
M  END

Associated Targets(non-human)

Plutella xylostella (1838 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 530.28Molecular Weight (Monoisotopic): 528.0541AlogP: 7.56#Rotatable Bonds: 10
Polar Surface Area: 45.51Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 1.07CX LogP: 7.67CX LogD: 7.67
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.25Np Likeness Score: -0.70

References

1. Li M, Liu CL, Zhang J, Wu Q, Hao SL, Song YQ..  (2013)  Design, synthesis and structure-activity relationship of novel insecticidal dichloro-allyloxy-phenol derivatives containing substituted pyrazol-3-ols.,  69  (5): [PMID:23139228] [10.1002/ps.3417]

Source