The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(4-(3-chloro-5-(trifluoromethyl)pyridin-2-yloxy)phenoxy)propanamidooxy)acetic acid ID: ALA2288767
PubChem CID: 76331136
Max Phase: Preclinical
Molecular Formula: C17H14ClF3N2O6
Molecular Weight: 434.75
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1)C(=O)NOCC(=O)O
Standard InChI: InChI=1S/C17H14ClF3N2O6/c1-9(15(26)23-27-8-14(24)25)28-11-2-4-12(5-3-11)29-16-13(18)6-10(7-22-16)17(19,20)21/h2-7,9H,8H2,1H3,(H,23,26)(H,24,25)
Standard InChI Key: ZKYDFQPKGNZSQV-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
24.5987 -17.2446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9960 -17.9567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8095 -17.9677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2267 -17.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8244 -16.5545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0123 -16.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6110 -15.8351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2084 -18.6809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0255 -18.6920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4245 -19.4052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4437 -17.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2608 -18.0010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0448 -17.2767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7939 -15.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3971 -15.1148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5807 -15.1060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1640 -15.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5696 -16.5243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3846 -16.5296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.6598 -18.7142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.4769 -18.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8758 -19.4385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6929 -19.4496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.4577 -20.1406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3468 -15.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9446 -15.0913 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.9318 -16.5066 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.5288 -15.7990 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.8148 -14.4125 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
3 8 1 0
8 9 1 0
9 10 1 0
9 11 1 0
11 12 1 0
11 13 2 0
7 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
12 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
17 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
15 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.75Molecular Weight (Monoisotopic): 434.0492AlogP: 3.45#Rotatable Bonds: 8Polar Surface Area: 106.98Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.14CX Basic pKa: 0.20CX LogP: 3.27CX LogD: -1.10Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.61Np Likeness Score: -1.45
References 1. MATSUMOTO K, IDE K, HAYASE Y, TAKAHASHI T, TAKEDA R, HAYASHI Y. (1996) Selective Herbicidal Activity of 3, 5-Dichloropyridyloxy-phenoxypropionamidoxyacetic Acid Derivatives between Wheat and Wild Oat, 21 (2): [10.1584/jpestics.21.165 ]