The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(4-(6-chloroquinoxalin-2-yloxy)phenoxy)propanamidooxy)acetic acid ID: ALA2288768
PubChem CID: 76331137
Max Phase: Preclinical
Molecular Formula: C19H16ClN3O6
Molecular Weight: 417.81
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1)C(=O)NOCC(=O)O
Standard InChI: InChI=1S/C19H16ClN3O6/c1-11(19(26)23-27-10-18(24)25)28-13-3-5-14(6-4-13)29-17-9-21-16-8-12(20)2-7-15(16)22-17/h2-9,11H,10H2,1H3,(H,23,26)(H,24,25)
Standard InChI Key: DQOOWYCQIUHVOE-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
34.2853 -16.5058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6826 -17.2179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4961 -17.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9133 -16.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5110 -15.8157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6989 -15.8082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2976 -15.0963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.8950 -17.9421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.7121 -17.9532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1111 -18.6664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1303 -17.2512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9474 -17.2623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.7314 -16.5380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.4805 -15.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0837 -14.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2673 -14.3673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.0713 -15.7908 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.3464 -17.9755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.1635 -17.9866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5624 -18.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3796 -18.7108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.1443 -19.4018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2562 -15.7855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8537 -15.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0346 -15.0618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6170 -15.7684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0245 -16.4847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8423 -16.4894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7999 -15.7617 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
3 8 1 0
8 9 1 0
9 10 1 0
9 11 1 0
11 12 1 0
11 13 2 0
7 14 1 0
14 15 2 0
15 16 1 0
16 24 2 0
23 17 2 0
17 14 1 0
12 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
20 22 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 417.81Molecular Weight (Monoisotopic): 417.0728AlogP: 2.98#Rotatable Bonds: 8Polar Surface Area: 119.87Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.14CX Basic pKa: 0.06CX LogP: 2.93CX LogD: -1.43Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.54Np Likeness Score: -1.26
References 1. MATSUMOTO K, IDE K, HAYASE Y, TAKAHASHI T, TAKEDA R, HAYASHI Y. (1996) Selective Herbicidal Activity of 3, 5-Dichloropyridyloxy-phenoxypropionamidoxyacetic Acid Derivatives between Wheat and Wild Oat, 21 (2): [10.1584/jpestics.21.165 ]