epoxy nimonol

ID: ALA2288867

PubChem CID: 15485379

Max Phase: Preclinical

Molecular Formula: C28H36O6

Molecular Weight: 468.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)O[C@@H]1[C@H](O)[C@H]2C(C)(C)C(=O)C=C[C@]2(C)[C@H]2CC[C@@]3(C)[C@H](c4ccoc4)C[C@H]4O[C@]43[C@]12C

Standard InChI:  InChI=1S/C28H36O6/c1-15(29)33-23-21(31)22-24(2,3)19(30)8-10-25(22,4)18-7-11-26(5)17(16-9-12-32-14-16)13-20-28(26,34-20)27(18,23)6/h8-10,12,14,17-18,20-23,31H,7,11,13H2,1-6H3/t17-,18+,20+,21+,22-,23+,25+,26-,27-,28+/m0/s1

Standard InChI Key:  MDSOLYLVXRNZBK-RFUZAODLSA-N

Molfile:  

     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
    3.7712   -9.5528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7712  -10.3783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4860  -10.7910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4855   -9.1404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1944   -9.5497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1989  -10.3794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9206  -10.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6335  -10.3845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9272   -9.1266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6335   -9.5697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6438   -7.9147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9272   -8.3284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3467   -8.3205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3528   -9.1781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1928   -9.3454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6470   -8.6522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1310   -8.0066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3493   -7.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1237   -6.9189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0825   -6.0950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2869   -5.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8347   -6.5676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0570  -10.7906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0735  -11.5054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8985  -11.5054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1944   -8.7247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6335   -8.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9206  -11.6302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3670  -10.8080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4160   -7.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3734  -11.6531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0879  -12.0656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6590  -12.0656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7653   -9.8926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  1  0
  6  3  1  1
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 12  1  1
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 14  1  0
 13 17  1  0
 15 16  1  0
 16 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 18  1  0
 17 18  1  6
  2 23  2  0
  3 24  1  0
  3 25  1  0
  5 26  1  1
 10 27  1  1
  7 28  1  6
  8 29  1  6
 13 30  1  6
 14 15  1  0
 29 31  1  0
 31 32  1  0
 31 33  2  0
 14 34  1  1
 15 34  1  1
M  END

Alternative Forms

  1. Parent:

    ALA2288867

    EPOXY NIMONOL

Associated Targets(non-human)

Spodoptera litura (1708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.59Molecular Weight (Monoisotopic): 468.2512AlogP: 4.42#Rotatable Bonds: 2
Polar Surface Area: 89.27Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.85CX Basic pKa: CX LogP: 3.90CX LogD: 3.90
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.51Np Likeness Score: 3.69

References

1. Suresh G, Gopalakrishnan G, Wesley SD, Pradeep Singh ND, Malathi R, Rajan SS..  (2002)  Insect antifeedant activity of tetranortriterpenoids from the Rutales. A perusal of structural relations.,  50  (16): [PMID:12137465] [10.1021/jf025534t]

Source