The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
epoxy azadiradione pp ID: ALA2288869
PubChem CID: 76327467
Max Phase: Preclinical
Molecular Formula: C28H34O8
Molecular Weight: 498.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)O[C@@H]1C[C@H]2C(C)(C)C(=O)C=C[C@]2(C)[C@H]2CC[C@@]3(C)[C@H](C4=CC(O)OC4=O)C(=O)[C@H]4O[C@]43[C@@]21C
Standard InChI: InChI=1S/C28H34O8/c1-13(29)34-18-12-16-24(2,3)17(30)8-9-25(16,4)15-7-10-26(5)20(14-11-19(31)35-23(14)33)21(32)22-28(26,36-22)27(15,18)6/h8-9,11,15-16,18-20,22,31H,7,10,12H2,1-6H3/t15-,16+,18-,19?,20-,22-,25-,26+,27+,28-/m1/s1
Standard InChI Key: KMGFDEJJTURBCE-BTEWWXTDSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
14.9165 -16.3707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9290 -15.5457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2040 -16.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7790 -16.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4916 -16.3582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7790 -17.5957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7040 -16.6332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1915 -15.9707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7165 -15.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2040 -17.5957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0666 -18.0082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0666 -16.3582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4916 -18.0082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2040 -15.1207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3540 -17.5957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1915 -14.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3540 -16.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4916 -15.5332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9165 -18.0082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9165 -18.8332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0165 -15.9707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2790 -13.8332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0290 -14.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9415 -13.8457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6040 -13.3457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6415 -18.0082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2040 -19.2457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9290 -14.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2040 -15.9457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7790 -15.9457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4790 -18.7206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6541 -18.7206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6415 -19.2457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5209 -15.2928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5952 -12.5129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1321 -17.1752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 5 1 0
5 3 1 0
6 13 1 1
7 1 1 0
8 7 1 0
9 2 1 0
10 3 1 0
11 6 1 0
12 4 1 0
13 10 1 0
14 2 1 0
15 11 1 0
9 16 1 6
17 12 2 0
5 18 1 1
10 19 1 6
20 19 1 0
21 8 2 0
22 23 1 0
23 16 1 0
24 16 2 0
25 24 1 0
26 15 2 0
27 20 2 0
2 28 1 6
3 29 1 1
4 30 1 1
31 11 1 0
32 11 1 0
33 20 1 0
8 9 1 0
14 18 1 0
4 6 1 0
17 15 1 0
22 25 1 0
23 34 2 0
25 35 1 0
1 36 1 1
7 36 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.57Molecular Weight (Monoisotopic): 498.2254AlogP: 2.67#Rotatable Bonds: 2Polar Surface Area: 119.50Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.80CX Basic pKa: ┄CX LogP: 3.43CX LogD: 3.43Aromatic Rings: ┄Heavy Atoms: 36QED Weighted: 0.46Np Likeness Score: 3.45
References 1. Suresh G, Gopalakrishnan G, Wesley SD, Pradeep Singh ND, Malathi R, Rajan SS.. (2002) Insect antifeedant activity of tetranortriterpenoids from the Rutales. A perusal of structural relations., 50 (16): [PMID:12137465 ] [10.1021/jf025534t ]