epoxy azadiradione pp

ID: ALA2288869

PubChem CID: 76327467

Max Phase: Preclinical

Molecular Formula: C28H34O8

Molecular Weight: 498.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)O[C@@H]1C[C@H]2C(C)(C)C(=O)C=C[C@]2(C)[C@H]2CC[C@@]3(C)[C@H](C4=CC(O)OC4=O)C(=O)[C@H]4O[C@]43[C@@]21C

Standard InChI:  InChI=1S/C28H34O8/c1-13(29)34-18-12-16-24(2,3)17(30)8-9-25(16,4)15-7-10-26(5)20(14-11-19(31)35-23(14)33)21(32)22-28(26,36-22)27(15,18)6/h8-9,11,15-16,18-20,22,31H,7,10,12H2,1-6H3/t15-,16+,18-,19?,20-,22-,25-,26+,27+,28-/m1/s1

Standard InChI Key:  KMGFDEJJTURBCE-BTEWWXTDSA-N

Molfile:  

     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   14.9165  -16.3707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9290  -15.5457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2040  -16.7707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7790  -16.7707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4916  -16.3582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7790  -17.5957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7040  -16.6332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1915  -15.9707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7165  -15.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2040  -17.5957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0666  -18.0082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0666  -16.3582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4916  -18.0082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2040  -15.1207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3540  -17.5957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1915  -14.6206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3540  -16.7707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4916  -15.5332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9165  -18.0082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9165  -18.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0165  -15.9707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2790  -13.8332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0290  -14.6206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9415  -13.8457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6040  -13.3457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6415  -18.0082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2040  -19.2457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9290  -14.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2040  -15.9457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7790  -15.9457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4790  -18.7206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6541  -18.7206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6415  -19.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5209  -15.2928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5952  -12.5129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1321  -17.1752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  5  1  0
  5  3  1  0
  6 13  1  1
  7  1  1  0
  8  7  1  0
  9  2  1  0
 10  3  1  0
 11  6  1  0
 12  4  1  0
 13 10  1  0
 14  2  1  0
 15 11  1  0
  9 16  1  6
 17 12  2  0
  5 18  1  1
 10 19  1  6
 20 19  1  0
 21  8  2  0
 22 23  1  0
 23 16  1  0
 24 16  2  0
 25 24  1  0
 26 15  2  0
 27 20  2  0
  2 28  1  6
  3 29  1  1
  4 30  1  1
 31 11  1  0
 32 11  1  0
 33 20  1  0
  8  9  1  0
 14 18  1  0
  4  6  1  0
 17 15  1  0
 22 25  1  0
 23 34  2  0
 25 35  1  0
  1 36  1  1
  7 36  1  1
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Spodoptera litura (1708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 498.57Molecular Weight (Monoisotopic): 498.2254AlogP: 2.67#Rotatable Bonds: 2
Polar Surface Area: 119.50Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.80CX Basic pKa: CX LogP: 3.43CX LogD: 3.43
Aromatic Rings: Heavy Atoms: 36QED Weighted: 0.46Np Likeness Score: 3.45

References

1. Suresh G, Gopalakrishnan G, Wesley SD, Pradeep Singh ND, Malathi R, Rajan SS..  (2002)  Insect antifeedant activity of tetranortriterpenoids from the Rutales. A perusal of structural relations.,  50  (16): [PMID:12137465] [10.1021/jf025534t]

Source