The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
salannin pp1 ID: ALA2288871
PubChem CID: 76313032
Max Phase: Preclinical
Molecular Formula: C34H44O11
Molecular Weight: 628.72
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C(\C)C(=O)O[C@H]1C[C@@H](OC(C)=O)[C@@]2(C)CO[C@H]3[C@H]4O[C@@H]5CC(C6=CC(=O)OC6O)=C(C)C5[C@@]4(C)[C@H](CC(=O)OC)[C@]1(C)[C@@H]32
Standard InChI: InChI=1S/C34H44O11/c1-9-15(2)30(38)44-23-13-22(42-17(4)35)32(5)14-41-27-28(32)33(23,6)21(12-24(36)40-8)34(7)26-16(3)18(10-20(26)43-29(27)34)19-11-25(37)45-31(19)39/h9,11,20-23,26-29,31,39H,10,12-14H2,1-8H3/b15-9+/t20-,21-,22-,23+,26?,27-,28+,29-,31?,32-,33+,34-/m1/s1
Standard InChI Key: WAYQENSGHSXFCW-LIYWTRNGSA-N
Molfile:
RDKit 2D
45 50 0 0 0 0 0 0 0 0999 V2000
7.3715 -13.6857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1623 -13.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9397 -13.6233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9147 -14.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3341 -14.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6826 -12.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1780 -14.8304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6764 -13.2445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6015 -14.8928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1082 -14.7971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6202 -14.1602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2487 -13.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4444 -13.1114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4870 -14.3850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1728 -15.6295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5786 -11.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4111 -13.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5245 -13.5609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5983 -15.5588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2903 -12.3622 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1353 -12.6618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7295 -14.7721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8169 -12.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7138 -12.4246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4464 -12.0499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0135 -14.3185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9594 -11.6212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1727 -11.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9095 -12.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6160 -11.0510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4173 -12.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0510 -13.4734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1373 -12.4870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1051 -11.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4881 -12.8741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9855 -12.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6327 -12.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5661 -15.4215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4839 -11.2258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7794 -13.1363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2560 -14.7097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3934 -12.2331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2123 -10.8471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5226 -11.3185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2486 -12.3421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 8 1 0
4 3 1 1
5 1 1 0
6 2 1 0
7 4 1 0
8 1 1 0
9 5 1 0
5 10 1 6
11 2 1 0
12 3 1 0
13 6 2 0
14 18 1 0
9 15 1 6
16 20 1 0
11 17 1 1
18 12 1 0
19 15 1 0
12 20 1 6
13 21 1 0
14 22 1 6
23 16 1 0
8 24 1 1
25 24 1 0
26 22 1 0
27 28 1 0
28 21 1 0
29 21 2 0
30 16 2 0
31 29 1 0
32 26 2 0
33 25 2 0
34 23 2 0
1 35 1 1
3 36 1 1
37 6 1 0
7 38 1 1
39 25 1 0
40 23 1 0
41 26 1 0
42 34 1 0
43 39 1 0
9 4 1 0
10 11 1 0
13 17 1 0
19 7 1 0
14 7 1 0
31 27 1 0
28 44 1 0
31 45 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 628.72Molecular Weight (Monoisotopic): 628.2884AlogP: 3.33#Rotatable Bonds: 6Polar Surface Area: 143.89Molecular Species: NEUTRALHBA: 11HBD: 1#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.86CX Basic pKa: ┄CX LogP: 2.67CX LogD: 2.67Aromatic Rings: ┄Heavy Atoms: 45QED Weighted: 0.26Np Likeness Score: 2.91
References 1. Suresh G, Gopalakrishnan G, Wesley SD, Pradeep Singh ND, Malathi R, Rajan SS.. (2002) Insect antifeedant activity of tetranortriterpenoids from the Rutales. A perusal of structural relations., 50 (16): [PMID:12137465 ] [10.1021/jf025534t ]