salannolide

ID: ALA2288872

PubChem CID: 76309326

Max Phase: Preclinical

Molecular Formula: C34H44O11

Molecular Weight: 628.72

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C/C=C(\C)C(=O)O[C@H]1C[C@@H](OC(C)=O)[C@@]2(C)CO[C@H]3[C@H]4O[C@@H]5C[C@@H](C6=CC(O)OC6=O)C(C)=C5[C@@]4(C)[C@H](CC(=O)OC)[C@]1(C)[C@@H]32

Standard InChI:  InChI=1S/C34H44O11/c1-9-15(2)30(38)44-23-13-22(42-17(4)35)32(5)14-41-27-28(32)33(23,6)21(12-24(36)40-8)34(7)26-16(3)18(10-20(26)43-29(27)34)19-11-25(37)45-31(19)39/h9,11,18,20-23,25,27-29,37H,10,12-14H2,1-8H3/b15-9+/t18-,20-,21-,22-,23+,25?,27-,28+,29-,32-,33+,34-/m1/s1

Standard InChI Key:  FVEVYGNIVRCALL-HTFNIQLJSA-N

Molfile:  

     RDKit          2D

 45 50  0  0  0  0  0  0  0  0999 V2000
    7.3715  -13.6857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1623  -13.4734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9397  -13.6233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9147  -14.4475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3341  -14.5099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6826  -12.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1780  -14.8304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6764  -13.2445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6015  -14.8928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1082  -14.7971    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6202  -14.1602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2487  -13.1863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4444  -13.1114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4870  -14.3850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1728  -15.6295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5786  -11.8959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4111  -13.9355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5245  -13.5609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5983  -15.5588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2903  -12.3622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1353  -12.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7295  -14.7721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8169  -12.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7138  -12.4246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4464  -12.0499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0135  -14.3185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9594  -11.6212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1727  -11.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9095  -12.9490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6160  -11.0510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4173  -12.3080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0510  -13.4734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1373  -12.4870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1051  -11.8210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4881  -12.8741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9855  -12.7992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6327  -12.0084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5661  -15.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4839  -11.2258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7794  -13.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2560  -14.7097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3934  -12.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2123  -10.8471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5226  -11.3185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2486  -12.3421    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  8  1  0
  4  3  1  1
  5  1  1  0
  6  2  2  0
  7  4  1  0
  8  1  1  0
  9  5  1  0
  5 10  1  6
 11  2  1  0
 12  3  1  0
 13  6  1  0
 14 18  1  0
  9 15  1  6
 16 20  1  0
 11 17  1  1
 18 12  1  0
 19 15  1  0
 12 20  1  6
 13 21  1  6
 14 22  1  6
 23 16  1  0
  8 24  1  1
 25 24  1  0
 26 22  1  0
 27 28  1  0
 28 21  1  0
 29 21  2  0
 30 16  2  0
 31 29  1  0
 32 26  2  0
 33 25  2  0
 34 23  2  0
  1 35  1  1
  3 36  1  1
 37  6  1  0
  7 38  1  1
 39 25  1  0
 40 23  1  0
 41 26  1  0
 42 34  1  0
 43 39  1  0
  9  4  1  0
 10 11  1  0
 13 17  1  0
 19  7  1  0
 14  7  1  0
 31 27  1  0
 28 44  2  0
 31 45  1  0
M  END

Alternative Forms

  1. Parent:

    ALA2288872

    SALANNOLIDE

Associated Targets(non-human)

Spodoptera litura (1708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 628.72Molecular Weight (Monoisotopic): 628.2884AlogP: 3.33#Rotatable Bonds: 6
Polar Surface Area: 143.89Molecular Species: NEUTRALHBA: 11HBD: 1
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.82CX Basic pKa: CX LogP: 2.90CX LogD: 2.90
Aromatic Rings: Heavy Atoms: 45QED Weighted: 0.20Np Likeness Score: 3.40

References

1. Suresh G, Gopalakrishnan G, Wesley SD, Pradeep Singh ND, Malathi R, Rajan SS..  (2002)  Insect antifeedant activity of tetranortriterpenoids from the Rutales. A perusal of structural relations.,  50  (16): [PMID:12137465] [10.1021/jf025534t]

Source