3-oxosalannin

ID: ALA2288875

PubChem CID: 76334734

Max Phase: Preclinical

Molecular Formula: C32H40O8

Molecular Weight: 552.66

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C/C=C(\C)C(=O)O[C@H]1CC(=O)[C@@]2(C)CO[C@H]3[C@H]4O[C@@H]5C[C@@H](c6ccoc6)C(C)=C5[C@@]4(C)[C@H](CC(=O)OC)[C@]1(C)[C@@H]32

Standard InChI:  InChI=1S/C32H40O8/c1-8-16(2)29(35)40-23-13-22(33)30(4)15-38-26-27(30)31(23,5)21(12-24(34)36-7)32(6)25-17(3)19(18-9-10-37-14-18)11-20(25)39-28(26)32/h8-10,14,19-21,23,26-28H,11-13,15H2,1-7H3/b16-8+/t19-,20-,21-,23+,26-,27+,28-,30-,31+,32-/m1/s1

Standard InChI Key:  VPBNAHBOBCHWHZ-BAPAGKJCSA-N

Molfile:  

     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
    7.3731  -13.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1641  -13.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9410  -13.6262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9160  -14.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3356  -14.5130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6845  -12.8269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1791  -14.8336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6778  -13.2474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6029  -14.8960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1099  -14.8003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6221  -14.1633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2498  -13.1891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4464  -13.1142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4880  -14.3881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1741  -15.6329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5796  -11.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4131  -13.9385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5254  -13.5638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5995  -15.5622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2915  -12.3648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1375  -12.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7303  -14.7753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8177  -12.2899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7153  -12.4273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4480  -12.0525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9618  -11.6237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1749  -11.8402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119  -12.9518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6170  -11.0534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4197  -12.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1391  -12.4897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1058  -11.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4897  -12.8768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9868  -12.8019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6346  -12.0110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5671  -15.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4855  -11.2282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7802  -13.1391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3939  -12.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2140  -10.8494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  8  1  0
  4  3  1  1
  5  1  1  0
  6  2  2  0
  7  4  1  0
  8  1  1  0
  9  5  1  0
  5 10  1  6
 11  2  1  0
 12  3  1  0
 13  6  1  0
 14 18  1  0
  9 15  1  6
 16 20  1  0
 11 17  1  1
 18 12  1  0
 19 15  1  0
 12 20  1  6
 13 21  1  6
 14 22  2  0
 23 16  1  0
  8 24  1  1
 25 24  1  0
 26 27  1  0
 27 21  2  0
 28 21  1  0
 29 16  2  0
 30 28  2  0
 31 25  2  0
 32 23  2  0
  1 33  1  1
  3 34  1  1
 35  6  1  0
  7 36  1  1
 37 25  1  0
 38 23  1  0
 39 32  1  0
 40 37  1  0
  9  4  1  0
 10 11  1  0
 13 17  1  0
 19  7  1  0
 14  7  1  0
 30 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA2288875

    3-OXOSALANNIN

Associated Targets(non-human)

Spodoptera litura (1708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 552.66Molecular Weight (Monoisotopic): 552.2723AlogP: 4.93#Rotatable Bonds: 5
Polar Surface Area: 101.27Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.31CX LogD: 4.31
Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.29Np Likeness Score: 3.20

References

1. Suresh G, Gopalakrishnan G, Wesley SD, Pradeep Singh ND, Malathi R, Rajan SS..  (2002)  Insect antifeedant activity of tetranortriterpenoids from the Rutales. A perusal of structural relations.,  50  (16): [PMID:12137465] [10.1021/jf025534t]

Source