The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
desacetyl salannolide ID: ALA2288876
PubChem CID: 76327468
Max Phase: Preclinical
Molecular Formula: C32H42O10
Molecular Weight: 586.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C(\C)C(=O)O[C@H]1C[C@@H](O)[C@@]2(C)CO[C@H]3[C@H]4O[C@@H]5C[C@@H](C6=CC(O)OC6=O)C(C)=C5[C@@]4(C)[C@H](CC(=O)OC)[C@]1(C)[C@@H]32
Standard InChI: InChI=1S/C32H42O10/c1-8-14(2)28(36)41-21-12-20(33)30(4)13-39-25-26(30)31(21,5)19(11-22(34)38-7)32(6)24-15(3)16(9-18(24)40-27(25)32)17-10-23(35)42-29(17)37/h8,10,16,18-21,23,25-27,33,35H,9,11-13H2,1-7H3/b14-8+/t16-,18-,19-,20-,21+,23?,25-,26+,27-,30-,31+,32-/m1/s1
Standard InChI Key: XXNRCIYKNVWIRZ-CACFRWDFSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
7.3715 -13.6857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1623 -13.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9397 -13.6233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9147 -14.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3341 -14.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6826 -12.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1780 -14.8304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6764 -13.2445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6015 -14.8928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1082 -14.7971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6202 -14.1602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2487 -13.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4444 -13.1114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4870 -14.3850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1728 -15.6295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5786 -11.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4111 -13.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5245 -13.5609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5983 -15.5588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2903 -12.3622 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1353 -12.6618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7295 -14.7721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8169 -12.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7138 -12.4246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4464 -12.0499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9594 -11.6212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1727 -11.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9095 -12.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6160 -11.0510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4173 -12.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1373 -12.4870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1051 -11.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4881 -12.8741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9855 -12.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6327 -12.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5661 -15.4215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4839 -11.2258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7794 -13.1363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3934 -12.2331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2123 -10.8471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5226 -11.3185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2486 -12.3421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 8 1 0
4 3 1 1
5 1 1 0
6 2 2 0
7 4 1 0
8 1 1 0
9 5 1 0
5 10 1 6
11 2 1 0
12 3 1 0
13 6 1 0
14 18 1 0
9 15 1 6
16 20 1 0
11 17 1 1
18 12 1 0
19 15 1 0
12 20 1 6
13 21 1 6
14 22 1 6
23 16 1 0
8 24 1 1
25 24 1 0
26 27 1 0
27 21 1 0
28 21 2 0
29 16 2 0
30 28 1 0
31 25 2 0
32 23 2 0
1 33 1 1
3 34 1 1
35 6 1 0
7 36 1 1
37 25 1 0
38 23 1 0
39 32 1 0
40 37 1 0
9 4 1 0
10 11 1 0
13 17 1 0
19 7 1 0
14 7 1 0
30 26 1 0
27 41 2 0
30 42 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.68Molecular Weight (Monoisotopic): 586.2778AlogP: 2.76#Rotatable Bonds: 5Polar Surface Area: 137.82Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.82CX Basic pKa: ┄CX LogP: 2.46CX LogD: 2.46Aromatic Rings: ┄Heavy Atoms: 42QED Weighted: 0.21Np Likeness Score: 3.50
References 1. Suresh G, Gopalakrishnan G, Wesley SD, Pradeep Singh ND, Malathi R, Rajan SS.. (2002) Insect antifeedant activity of tetranortriterpenoids from the Rutales. A perusal of structural relations., 50 (16): [PMID:12137465 ] [10.1021/jf025534t ]