nimbin MW

ID: ALA2288879

PubChem CID: 11157183

Max Phase: Preclinical

Molecular Formula: C30H36O10

Molecular Weight: 556.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)C[C@H]1[C@]2(C)C3=C(C)[C@H](C4=CCOC4=O)C[C@H]3O[C@@H]2[C@H](OC(C)=O)[C@@H]2[C@]1(C)C(=O)C=C[C@@]2(C)C(=O)OC

Standard InChI:  InChI=1S/C30H36O10/c1-14-17(16-9-11-38-26(16)34)12-18-22(14)30(5)19(13-21(33)36-6)29(4)20(32)8-10-28(3,27(35)37-7)24(29)23(25(30)40-18)39-15(2)31/h8-10,17-19,23-25H,11-13H2,1-7H3/t17-,18-,19-,23-,24+,25-,28-,29+,30-/m1/s1

Standard InChI Key:  RDRMCWCVTKDOOP-IAHBDJIOSA-N

Molfile:  

     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   25.3285   -9.4552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1302   -9.2389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9032   -9.3916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2903  -10.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6392   -8.5942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8650  -10.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6370   -9.0141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5608  -10.6642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0666  -10.5709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.5756   -9.9303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1354  -10.6005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4113   -8.8826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4355  -10.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3731   -9.7055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2032   -8.9505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1270  -11.4489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0985   -8.4287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4779   -9.3322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5056  -11.9834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6752   -8.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1970  -12.4161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4049   -7.8051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9299   -7.3810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1366   -7.6057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8747   -8.7172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8650  -11.8816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.3880   -8.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2032   -8.1232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.9266  -12.0428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0963   -8.2548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4557   -8.6408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9414   -8.5687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5926   -7.7670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3761  -11.8689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3040  -10.8169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4388   -6.9822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1630  -13.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3761  -12.7258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1726   -6.6089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4723   -7.0789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  7  1  0
  4  1  1  0
  5  2  2  0
  6  3  1  1
  7  1  1  0
  8  4  1  0
  4  9  1  6
 10  2  1  0
 11  6  1  0
 12  5  1  0
 13 18  2  0
 10 14  1  1
 15  3  1  0
 16 11  1  0
 12 17  1  6
 18 15  1  0
  8 19  1  6
  7 20  1  1
 21 19  1  0
 22 20  1  0
 23 24  1  0
 24 17  1  0
 25 17  2  0
 26 16  2  0
 27 25  1  0
 28 15  2  0
 29 21  2  0
 30 22  2  0
  1 31  1  1
  3 32  1  1
 33  5  1  0
 34 16  1  0
 11 35  1  1
 36 22  1  0
 37 21  1  0
 38 34  1  0
 39 36  1  0
  6  8  1  0
 10  9  1  0
 14 12  1  0
 11 13  1  0
 23 27  1  0
 24 40  2  0
M  END

Alternative Forms

  1. Parent:

    ALA2288879

    NIMBIN MW

Associated Targets(non-human)

Spodoptera litura (1708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 556.61Molecular Weight (Monoisotopic): 556.2308AlogP: 2.65#Rotatable Bonds: 5
Polar Surface Area: 131.50Molecular Species: NEUTRALHBA: 10HBD:
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.33CX Basic pKa: CX LogP: 2.37CX LogD: 2.37
Aromatic Rings: Heavy Atoms: 40QED Weighted: 0.28Np Likeness Score: 3.03

References

1. Suresh G, Gopalakrishnan G, Wesley SD, Pradeep Singh ND, Malathi R, Rajan SS..  (2002)  Insect antifeedant activity of tetranortriterpenoids from the Rutales. A perusal of structural relations.,  50  (16): [PMID:12137465] [10.1021/jf025534t]

Source