The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
desacetylnimbin MW ID: ALA2288880
PubChem CID: 11733993
Max Phase: Preclinical
Molecular Formula: C28H34O9
Molecular Weight: 514.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C[C@H]1[C@]2(C)C3=C(C)[C@H](C4=CCOC4=O)C[C@H]3O[C@@H]2[C@H](O)[C@@H]2[C@]1(C)C(=O)C=C[C@@]2(C)C(=O)OC
Standard InChI: InChI=1S/C28H34O9/c1-13-15(14-8-10-36-24(14)32)11-16-20(13)28(4)17(12-19(30)34-5)27(3)18(29)7-9-26(2,25(33)35-6)22(27)21(31)23(28)37-16/h7-9,15-17,21-23,31H,10-12H2,1-6H3/t15-,16-,17-,21-,22+,23-,26-,27+,28-/m1/s1
Standard InChI Key: GIAFAFYWTVKNOC-HLWYWVJFSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
25.3403 -9.4596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1424 -9.2432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9143 -9.3960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3021 -10.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6517 -8.5982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8762 -10.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6485 -9.0183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5722 -10.6692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0787 -10.5758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5880 -9.9349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1462 -10.6054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4241 -8.8867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4459 -10.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3858 -9.7100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2141 -8.9547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1378 -11.4543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1116 -8.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4884 -9.3366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6867 -8.1950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4167 -7.8088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9434 -7.3844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1497 -7.6093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8881 -8.7212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8762 -11.8872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.4017 -8.0803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2141 -8.1270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1084 -8.2586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4676 -8.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9526 -8.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6050 -7.7706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3865 -11.8744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3144 -10.8219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4506 -6.9854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3865 -12.7317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1848 -6.6120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5351 -11.5167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4851 -7.0822 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 7 1 0
4 1 1 0
5 2 2 0
6 3 1 1
7 1 1 0
8 4 1 0
4 9 1 6
10 2 1 0
11 6 1 0
12 5 1 0
13 18 2 0
10 14 1 1
15 3 1 0
16 11 1 0
12 17 1 6
18 15 1 0
7 19 1 1
20 19 1 0
21 22 1 0
22 17 1 0
23 17 2 0
24 16 2 0
25 23 1 0
26 15 2 0
27 20 2 0
1 28 1 1
3 29 1 1
30 5 1 0
31 16 1 0
11 32 1 1
33 20 1 0
34 31 1 0
35 33 1 0
6 8 1 0
10 9 1 0
14 12 1 0
11 13 1 0
21 25 1 0
8 36 1 6
22 37 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 514.57Molecular Weight (Monoisotopic): 514.2203AlogP: 2.07#Rotatable Bonds: 4Polar Surface Area: 125.43Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.21CX Basic pKa: ┄CX LogP: 1.93CX LogD: 1.93Aromatic Rings: ┄Heavy Atoms: 37QED Weighted: 0.34Np Likeness Score: 3.09
References 1. Suresh G, Gopalakrishnan G, Wesley SD, Pradeep Singh ND, Malathi R, Rajan SS.. (2002) Insect antifeedant activity of tetranortriterpenoids from the Rutales. A perusal of structural relations., 50 (16): [PMID:12137465 ] [10.1021/jf025534t ]