desacetylnimbin MW

ID: ALA2288880

PubChem CID: 11733993

Max Phase: Preclinical

Molecular Formula: C28H34O9

Molecular Weight: 514.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)C[C@H]1[C@]2(C)C3=C(C)[C@H](C4=CCOC4=O)C[C@H]3O[C@@H]2[C@H](O)[C@@H]2[C@]1(C)C(=O)C=C[C@@]2(C)C(=O)OC

Standard InChI:  InChI=1S/C28H34O9/c1-13-15(14-8-10-36-24(14)32)11-16-20(13)28(4)17(12-19(30)34-5)27(3)18(29)7-9-26(2,25(33)35-6)22(27)21(31)23(28)37-16/h7-9,15-17,21-23,31H,10-12H2,1-6H3/t15-,16-,17-,21-,22+,23-,26-,27+,28-/m1/s1

Standard InChI Key:  GIAFAFYWTVKNOC-HLWYWVJFSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   25.3403   -9.4596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1424   -9.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9143   -9.3960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3021  -10.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6517   -8.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8762  -10.2235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6485   -9.0183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5722  -10.6692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0787  -10.5758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.5880   -9.9349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1462  -10.6054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4241   -8.8867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4459  -10.1599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3858   -9.7100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2141   -8.9547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1378  -11.4543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1116   -8.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4884   -9.3366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6867   -8.1950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4167   -7.8088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9434   -7.3844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1497   -7.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8881   -8.7212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8762  -11.8872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.4017   -8.0803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2141   -8.1270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1084   -8.2586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4676   -8.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9526   -8.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6050   -7.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3865  -11.8744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3144  -10.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4506   -6.9854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3865  -12.7317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1848   -6.6120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5351  -11.5167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4851   -7.0822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  7  1  0
  4  1  1  0
  5  2  2  0
  6  3  1  1
  7  1  1  0
  8  4  1  0
  4  9  1  6
 10  2  1  0
 11  6  1  0
 12  5  1  0
 13 18  2  0
 10 14  1  1
 15  3  1  0
 16 11  1  0
 12 17  1  6
 18 15  1  0
  7 19  1  1
 20 19  1  0
 21 22  1  0
 22 17  1  0
 23 17  2  0
 24 16  2  0
 25 23  1  0
 26 15  2  0
 27 20  2  0
  1 28  1  1
  3 29  1  1
 30  5  1  0
 31 16  1  0
 11 32  1  1
 33 20  1  0
 34 31  1  0
 35 33  1  0
  6  8  1  0
 10  9  1  0
 14 12  1  0
 11 13  1  0
 21 25  1  0
  8 36  1  6
 22 37  2  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Spodoptera litura (1708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 514.57Molecular Weight (Monoisotopic): 514.2203AlogP: 2.07#Rotatable Bonds: 4
Polar Surface Area: 125.43Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.21CX Basic pKa: CX LogP: 1.93CX LogD: 1.93
Aromatic Rings: Heavy Atoms: 37QED Weighted: 0.34Np Likeness Score: 3.09

References

1. Suresh G, Gopalakrishnan G, Wesley SD, Pradeep Singh ND, Malathi R, Rajan SS..  (2002)  Insect antifeedant activity of tetranortriterpenoids from the Rutales. A perusal of structural relations.,  50  (16): [PMID:12137465] [10.1021/jf025534t]

Source