(3aR,4R,9R,9aR)-6,7-dimethoxy-1-oxo-9-(3,4,5-trimethoxyphenyl)-1,3,3a,4,9,9a-hexahydronaphtho[2,3-c]furan-4-yl butyrate

ID: ALA2288936

PubChem CID: 71541308

Max Phase: Preclinical

Molecular Formula: C27H32O9

Molecular Weight: 500.54

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCCC(=O)O[C@H]1c2cc(OC)c(OC)cc2[C@@H](c2cc(OC)c(OC)c(OC)c2)[C@H]2C(=O)OC[C@@H]21

Standard InChI:  InChI=1S/C27H32O9/c1-7-8-22(28)36-25-16-12-19(31-3)18(30-2)11-15(16)23(24-17(25)13-35-27(24)29)14-9-20(32-4)26(34-6)21(10-14)33-5/h9-12,17,23-25H,7-8,13H2,1-6H3/t17-,23+,24-,25-/m0/s1

Standard InChI Key:  ZSEDCKGXJIOLPV-VUHWMDJISA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   14.5812  -10.0236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5794   -8.3862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2881   -8.7915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2869   -9.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9970  -10.0280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9993   -8.3776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7140   -8.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7107   -9.6168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4927   -9.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9794   -9.2102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4980   -8.5423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8732   -9.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8744   -8.7981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0982   -8.5446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0962   -9.8657    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9994   -7.5604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9960  -10.8452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2886  -11.2506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2873  -12.0670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9951  -12.4773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7056  -12.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7034  -11.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7422  -10.6526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5789  -12.4744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8719  -12.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9952  -13.2945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2875  -13.7032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4143  -12.4721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4162  -13.2893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9295   -7.7450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9251  -10.6648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7071   -7.1519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7071   -6.3347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4148   -7.5605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9995   -5.9261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9995   -5.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 12  1  1  0
  1  4  2  0
  3  2  2  0
  2 13  1  0
  3  4  1  0
  3  6  1  0
  4  5  1  0
  5  8  1  0
  7  6  1  0
  7  8  1  0
  8  9  1  6
  9 10  1  0
 10 11  1  0
  7 11  1  1
 12 13  2  0
 13 14  1  0
 15 12  1  0
  6 16  1  6
  5 17  1  6
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  9 23  2  0
 19 24  1  0
 24 25  1  0
 20 26  1  0
 26 27  1  0
 21 28  1  0
 28 29  1  0
 14 30  1  0
 15 31  1  0
 16 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
 35 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2288936

   [(3aR,4R,9R,9aR)-6,7-dimethoxy-1-oxo-9-(3,4,5-trimethoxyphenyl)-3a,4,9,9a-tetrahydro-3H-benzo[f][2]benzofuran-4-yl] butanoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 500.54

Molecular Weight (Monoisotopic): 500.2046

AlogP: 4.05

#Rotatable Bonds: 9

Polar Surface Area: 98.75

Molecular Species: NEUTRAL

HBA: 9

HBD: ┄

#RO5 Violations: 1

HBA (Lipinski): 9

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 3.27

CX LogD: 3.27

Aromatic Rings: 2

Heavy Atoms: 36

QED Weighted: 0.47

Np Likeness Score: 1.33

References

1. He S, Shao Y, Fan L, Che Z, Xu H, Zhi X, Wang J, Yao X, Qu H..  (2013)  Synthesis and quantitative structure-activity relationship (QSAR) study of novel 4-acyloxypodophyllotoxin derivatives modified in the A and C rings as insecticidal agents.,  61  (3): [PMID:23278333] [10.1021/jf305011n]

Source

Source(1):

• Scientific Literature