(3aR,4R,9R,9aR)-6,7-dimethoxy-1-oxo-9-(3,4,5-trimethoxyphenyl)-1,3,3a,4,9,9a-hexahydronaphtho[2,3-c]furan-4-yl hexanoate

ID: ALA2288937

PubChem CID: 71541309

Max Phase: Preclinical

Molecular Formula: C29H36O9

Molecular Weight: 528.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCC(=O)O[C@H]1c2cc(OC)c(OC)cc2[C@@H](c2cc(OC)c(OC)c(OC)c2)[C@H]2C(=O)OC[C@@H]21

Standard InChI:  InChI=1S/C29H36O9/c1-7-8-9-10-24(30)38-27-18-14-21(33-3)20(32-2)13-17(18)25(26-19(27)15-37-29(26)31)16-11-22(34-4)28(36-6)23(12-16)35-5/h11-14,19,25-27H,7-10,15H2,1-6H3/t19-,25+,26-,27-/m0/s1

Standard InChI Key:  JSWYQIBXGBJLJB-VIIGGRGYSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   20.9578  -10.3620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9560   -8.7247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6646   -9.1299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6634   -9.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3735  -10.3664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3759   -8.7161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0906   -9.1320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0873   -9.9553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8693  -10.2128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3559   -9.5486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8746   -8.8807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2497   -9.9531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2510   -9.1365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4748   -8.8830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4728  -10.2041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3759   -7.8989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3726  -11.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6652  -11.5890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6639  -12.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3716  -12.8157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0822  -12.4036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0800  -11.5885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1187  -10.9910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9555  -12.8129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2485  -12.4031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3717  -13.6329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6641  -14.0416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7908  -12.8106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.7927  -13.6278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3061   -8.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3016  -11.0032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0837   -7.4903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0837   -6.6731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7914   -7.8989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3760   -6.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3761   -5.4473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6684   -5.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6684   -4.2215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 12  1  1  0
  1  4  2  0
  3  2  2  0
  2 13  1  0
  3  4  1  0
  3  6  1  0
  4  5  1  0
  5  8  1  0
  7  6  1  0
  7  8  1  0
  8  9  1  6
  9 10  1  0
 10 11  1  0
  7 11  1  1
 12 13  2  0
 13 14  1  0
 15 12  1  0
  6 16  1  6
  5 17  1  6
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  9 23  2  0
 19 24  1  0
 24 25  1  0
 20 26  1  0
 26 27  1  0
 21 28  1  0
 28 29  1  0
 14 30  1  0
 15 31  1  0
 16 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Associated Targets(non-human)

Mythimna separata (3306 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 528.60Molecular Weight (Monoisotopic): 528.2359AlogP: 4.83#Rotatable Bonds: 11
Polar Surface Area: 98.75Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.16CX LogD: 4.16
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.30Np Likeness Score: 1.29

References

1. He S, Shao Y, Fan L, Che Z, Xu H, Zhi X, Wang J, Yao X, Qu H..  (2013)  Synthesis and quantitative structure-activity relationship (QSAR) study of novel 4-acyloxypodophyllotoxin derivatives modified in the A and C rings as insecticidal agents.,  61  (3): [PMID:23278333] [10.1021/jf305011n]

Source