(3aR,4R,9R,9aR)-6,7-dimethoxy-1-oxo-9-(3,4,5-trimethoxyphenyl)-1,3,3a,4,9,9a-hexahydronaphtho[2,3-c]furan-4-yl octanoate

ID: ALA2288938

PubChem CID: 71541411

Max Phase: Preclinical

Molecular Formula: C31H40O9

Molecular Weight: 556.65

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCC(=O)O[C@H]1c2cc(OC)c(OC)cc2[C@@H](c2cc(OC)c(OC)c(OC)c2)[C@H]2C(=O)OC[C@@H]21

Standard InChI:  InChI=1S/C31H40O9/c1-7-8-9-10-11-12-26(32)40-29-20-16-23(35-3)22(34-2)15-19(20)27(28-21(29)17-39-31(28)33)18-13-24(36-4)30(38-6)25(14-18)37-5/h13-16,21,27-29H,7-12,17H2,1-6H3/t21-,27+,28-,29-/m0/s1

Standard InChI Key:  IBQVWUONPLDQKU-RUZQMMQPSA-N

Molfile:  

     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
   27.1074   -9.9617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1056   -8.3243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8142   -8.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8130   -9.5548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5231   -9.9661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5255   -8.3157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2401   -8.7316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2369   -9.5549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0189   -9.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5055   -9.1483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.0242   -8.4804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3993   -9.5527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4005   -8.7362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6243   -8.4827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6224   -9.8038    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5255   -7.4985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5221  -10.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8148  -11.1887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8134  -12.0051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5212  -12.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2317  -12.0033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2296  -11.1882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2683  -10.5907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1050  -12.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3980  -12.0027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5213  -13.2326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.8136  -13.6413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9404  -12.4102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9423  -13.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4557   -7.6831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4512  -10.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2332   -7.0900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2333   -6.2728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9409   -7.4986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5256   -5.8642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5256   -5.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8179   -4.6383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8180   -3.8211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1103   -3.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1103   -2.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 12  1  1  0
  1  4  2  0
  3  2  2  0
  2 13  1  0
  3  4  1  0
  3  6  1  0
  4  5  1  0
  5  8  1  0
  7  6  1  0
  7  8  1  0
  8  9  1  6
  9 10  1  0
 10 11  1  0
  7 11  1  1
 12 13  2  0
 13 14  1  0
 15 12  1  0
  6 16  1  6
  5 17  1  6
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  9 23  2  0
 19 24  1  0
 24 25  1  0
 20 26  1  0
 26 27  1  0
 21 28  1  0
 28 29  1  0
 14 30  1  0
 15 31  1  0
 16 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
M  END

Associated Targets(non-human)

Mythimna separata (3306 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 556.65Molecular Weight (Monoisotopic): 556.2672AlogP: 5.61#Rotatable Bonds: 13
Polar Surface Area: 98.75Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 5.05CX LogD: 5.05
Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.23Np Likeness Score: 1.25

References

1. He S, Shao Y, Fan L, Che Z, Xu H, Zhi X, Wang J, Yao X, Qu H..  (2013)  Synthesis and quantitative structure-activity relationship (QSAR) study of novel 4-acyloxypodophyllotoxin derivatives modified in the A and C rings as insecticidal agents.,  61  (3): [PMID:23278333] [10.1021/jf305011n]

Source