(3aR,4R,9R,9aR)-6,7-dimethoxy-1-oxo-9-(3,4,5-trimethoxyphenyl)-1,3,3a,4,9,9a-hexahydronaphtho[2,3-c]furan-4-yl benzoate

ID: ALA2288941

PubChem CID: 71541414

Max Phase: Preclinical

Molecular Formula: C30H30O9

Molecular Weight: 534.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2c(cc1OC)[C@H](OC(=O)c1ccccc1)[C@H]1COC(=O)[C@@H]1[C@@H]2c1cc(OC)c(OC)c(OC)c1

Standard InChI:  InChI=1S/C30H30O9/c1-33-21-13-18-19(14-22(21)34-2)27(39-29(31)16-9-7-6-8-10-16)20-15-38-30(32)26(20)25(18)17-11-23(35-3)28(37-5)24(12-17)36-4/h6-14,20,25-27H,15H2,1-5H3/t20-,25+,26-,27-/m0/s1

Standard InChI Key:  ANRHSVDZMKTBDT-JYIOINSGSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    8.1180  -18.7609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1162  -17.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8248  -17.5288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8236  -18.3540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5337  -18.7654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5361  -17.1150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2508  -17.5309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2475  -18.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0295  -18.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5161  -17.9475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0348  -17.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4099  -18.3520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4112  -17.5354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6350  -17.2819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6330  -18.6031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5361  -16.2978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5327  -19.5825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8254  -19.9880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8241  -20.8044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5318  -21.2147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2424  -20.8025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2402  -19.9874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2789  -19.3899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1157  -21.2118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4086  -20.8020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5319  -22.0318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8243  -22.4405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9510  -21.2095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9529  -22.0267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4663  -16.4823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4618  -19.4021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2439  -15.8892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2439  -15.0720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9516  -16.2979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9510  -14.6672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9513  -13.8508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2431  -13.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5330  -13.8543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5361  -14.6693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 12  1  1  0
  1  4  2  0
  3  2  2  0
  2 13  1  0
  3  4  1  0
  3  6  1  0
  4  5  1  0
  5  8  1  0
  7  6  1  0
  7  8  1  0
  8  9  1  6
  9 10  1  0
 10 11  1  0
  7 11  1  1
 12 13  2  0
 13 14  1  0
 15 12  1  0
  6 16  1  6
  5 17  1  6
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  9 23  2  0
 19 24  1  0
 24 25  1  0
 20 26  1  0
 26 27  1  0
 21 28  1  0
 28 29  1  0
 14 30  1  0
 15 31  1  0
 16 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 33  1  0
M  END

Associated Targets(non-human)

Mythimna separata (3306 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 534.56Molecular Weight (Monoisotopic): 534.1890AlogP: 4.56#Rotatable Bonds: 8
Polar Surface Area: 98.75Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.18CX LogD: 4.18
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.39Np Likeness Score: 1.11

References

1. He S, Shao Y, Fan L, Che Z, Xu H, Zhi X, Wang J, Yao X, Qu H..  (2013)  Synthesis and quantitative structure-activity relationship (QSAR) study of novel 4-acyloxypodophyllotoxin derivatives modified in the A and C rings as insecticidal agents.,  61  (3): [PMID:23278333] [10.1021/jf305011n]

Source