(3aR,4R,9R,9aR)-6,7-dimethoxy-1-oxo-9-(3,4,5-trimethoxyphenyl)-1,3,3a,4,9,9a-hexahydronaphtho[2,3-c]furan-4-yl 3-chlorobenzoate

ID: ALA2288943

PubChem CID: 71541509

Max Phase: Preclinical

Molecular Formula: C30H29ClO9

Molecular Weight: 569.01

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2c(cc1OC)[C@H](OC(=O)c1cccc(Cl)c1)[C@H]1COC(=O)[C@@H]1[C@@H]2c1cc(OC)c(OC)c(OC)c1

Standard InChI:  InChI=1S/C30H29ClO9/c1-34-21-12-18-19(13-22(21)35-2)27(40-29(32)15-7-6-8-17(31)9-15)20-14-39-30(33)26(20)25(18)16-10-23(36-3)28(38-5)24(11-16)37-4/h6-13,20,25-27H,14H2,1-5H3/t20-,25+,26-,27-/m0/s1

Standard InChI Key:  BUPNEKATUDEVFZ-JYIOINSGSA-N

Molfile:  

     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   21.2343  -19.3140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2325  -17.6766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9411  -18.0819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9400  -18.9071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6501  -19.3184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6524  -17.6680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3671  -18.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3638  -18.9072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1458  -19.1648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6325  -18.5006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1511  -17.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5263  -18.9050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5275  -18.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7513  -17.8350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7493  -19.1561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6525  -16.8508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6491  -20.1356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9417  -20.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9404  -21.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6481  -21.7677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3587  -21.3556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3565  -20.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3953  -19.9430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2320  -21.7648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5250  -21.3550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6482  -22.5849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9406  -22.9936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0674  -21.7625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0693  -22.5797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5826  -17.0354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5782  -19.9552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3602  -16.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3602  -15.6251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0679  -16.8509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0673  -15.2202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0677  -14.4038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3594  -13.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6494  -14.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6525  -15.2224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7756  -13.9956    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 12  1  1  0
  1  4  2  0
  3  2  2  0
  2 13  1  0
  3  4  1  0
  3  6  1  0
  4  5  1  0
  5  8  1  0
  7  6  1  0
  7  8  1  0
  8  9  1  6
  9 10  1  0
 10 11  1  0
  7 11  1  1
 12 13  2  0
 13 14  1  0
 15 12  1  0
  6 16  1  6
  5 17  1  6
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  9 23  2  0
 19 24  1  0
 24 25  1  0
 20 26  1  0
 26 27  1  0
 21 28  1  0
 28 29  1  0
 14 30  1  0
 15 31  1  0
 16 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 33  1  0
 36 40  1  0
M  END

Associated Targets(non-human)

Mythimna separata (3306 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 569.01Molecular Weight (Monoisotopic): 568.1500AlogP: 5.22#Rotatable Bonds: 8
Polar Surface Area: 98.75Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 4.78CX LogD: 4.78
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.34Np Likeness Score: 0.85

References

1. He S, Shao Y, Fan L, Che Z, Xu H, Zhi X, Wang J, Yao X, Qu H..  (2013)  Synthesis and quantitative structure-activity relationship (QSAR) study of novel 4-acyloxypodophyllotoxin derivatives modified in the A and C rings as insecticidal agents.,  61  (3): [PMID:23278333] [10.1021/jf305011n]

Source