(3aR,4R,9R,9aR)-6,7-dimethoxy-1-oxo-9-(3,4,5-trimethoxyphenyl)-1,3,3a,4,9,9a-hexahydronaphtho[2,3-c]furan-4-yl 3-nitrobenzoate

ID: ALA2288945

PubChem CID: 71541511

Max Phase: Preclinical

Molecular Formula: C30H29NO11

Molecular Weight: 579.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2c(cc1OC)[C@H](OC(=O)c1cccc([N+](=O)[O-])c1)[C@H]1COC(=O)[C@@H]1[C@@H]2c1cc(OC)c(OC)c(OC)c1

Standard InChI:  InChI=1S/C30H29NO11/c1-36-21-12-18-19(13-22(21)37-2)27(42-29(32)15-7-6-8-17(9-15)31(34)35)20-14-41-30(33)26(20)25(18)16-10-23(38-3)28(40-5)24(11-16)39-4/h6-13,20,25-27H,14H2,1-5H3/t20-,25+,26-,27-/m0/s1

Standard InChI Key:  BPGSCNOHCGMLIM-JYIOINSGSA-N

Molfile:  

     RDKit          2D

 42 46  0  0  0  0  0  0  0  0999 V2000
   35.2463  -18.9384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2445  -17.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9531  -17.7063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9519  -18.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6620  -18.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6644  -17.2924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3790  -17.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3758  -18.5317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1578  -18.7892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6444  -18.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.1631  -17.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5382  -18.5294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5394  -17.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7632  -17.4594    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7613  -18.7805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6644  -16.4753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6610  -19.7600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9537  -20.1654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9523  -20.9819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6601  -21.3921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3706  -20.9800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3685  -20.1649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4072  -19.5674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.2439  -21.3893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.5369  -20.9795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6602  -22.2093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.9525  -22.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0793  -21.3869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.0812  -22.2041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5946  -16.6598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5901  -19.5796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3721  -16.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3722  -15.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0798  -16.4753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.0792  -14.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0796  -14.0282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3714  -13.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6613  -14.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6644  -14.8468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7877  -13.6156    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.7881  -12.7984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.4952  -14.0246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 12  1  1  0
  1  4  2  0
  3  2  2  0
  2 13  1  0
  3  4  1  0
  3  6  1  0
  4  5  1  0
  5  8  1  0
  7  6  1  0
  7  8  1  0
  8  9  1  6
  9 10  1  0
 10 11  1  0
  7 11  1  1
 12 13  2  0
 13 14  1  0
 15 12  1  0
  6 16  1  6
  5 17  1  6
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  9 23  2  0
 19 24  1  0
 24 25  1  0
 20 26  1  0
 26 27  1  0
 21 28  1  0
 28 29  1  0
 14 30  1  0
 15 31  1  0
 16 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 33  1  0
 40 41  2  0
 40 42  1  0
 36 40  1  0
M  CHG  2  40   1  42  -1
M  END

Associated Targets(non-human)

Mythimna separata (3306 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 579.56Molecular Weight (Monoisotopic): 579.1741AlogP: 4.47#Rotatable Bonds: 9
Polar Surface Area: 141.89Molecular Species: NEUTRALHBA: 11HBD:
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 4.12CX LogD: 4.12
Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.20Np Likeness Score: 0.69

References

1. He S, Shao Y, Fan L, Che Z, Xu H, Zhi X, Wang J, Yao X, Qu H..  (2013)  Synthesis and quantitative structure-activity relationship (QSAR) study of novel 4-acyloxypodophyllotoxin derivatives modified in the A and C rings as insecticidal agents.,  61  (3): [PMID:23278333] [10.1021/jf305011n]

Source