(3aR,4S,9R,9aR)-6,7-dimethoxy-1-oxo-9-(3,4,5-trimethoxyphenyl)-1,3,3a,4,9,9a-hexahydronaphtho[2,3-c]furan-4-yl butyrate

ID: ALA2288947

PubChem CID: 71541513

Max Phase: Preclinical

Molecular Formula: C27H32O9

Molecular Weight: 500.54

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCCC(=O)O[C@@H]1c2cc(OC)c(OC)cc2[C@@H](c2cc(OC)c(OC)c(OC)c2)[C@H]2C(=O)OC[C@@H]21

Standard InChI:  InChI=1S/C27H32O9/c1-7-8-22(28)36-25-16-12-19(31-3)18(30-2)11-15(16)23(24-17(25)13-35-27(24)29)14-9-20(32-4)26(34-6)21(10-14)33-5/h9-12,17,23-25H,7-8,13H2,1-6H3/t17-,23+,24-,25+/m0/s1

Standard InChI Key:  ZSEDCKGXJIOLPV-AKEHSPCASA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   10.3797  -26.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3779  -25.2418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0865  -25.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0854  -26.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7954  -26.8836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7978  -25.2332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5125  -25.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5092  -26.4724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2912  -26.7300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7779  -26.0658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2965  -25.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6717  -26.4702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6729  -25.6537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8967  -25.4002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8947  -26.7213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7979  -24.4160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7945  -27.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0871  -28.1062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0858  -28.9226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7935  -29.3329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5041  -28.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5019  -28.1057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5406  -27.5082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3774  -29.3300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6704  -28.9203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7936  -30.1501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0860  -30.5588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2127  -29.3277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2146  -30.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7280  -24.6006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7236  -27.5204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5056  -24.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5056  -23.1903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2133  -24.4161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7979  -22.7817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7980  -21.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 12  1  1  0
  1  4  2  0
  3  2  2  0
  2 13  1  0
  3  4  1  0
  3  6  1  0
  4  5  1  0
  5  8  1  0
  7  6  1  0
  7  8  1  0
  8  9  1  6
  9 10  1  0
 10 11  1  0
  7 11  1  1
 12 13  2  0
 13 14  1  0
 15 12  1  0
  6 16  1  1
  5 17  1  6
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  9 23  2  0
 19 24  1  0
 24 25  1  0
 20 26  1  0
 26 27  1  0
 21 28  1  0
 28 29  1  0
 14 30  1  0
 15 31  1  0
 16 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
 35 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2288947

   [(3aR,4S,9R,9aR)-6,7-dimethoxy-1-oxo-9-(3,4,5-trimethoxyphenyl)-3a,4,9,9a-tetrahydro-3H-benzo[f][2]benzofuran-4-yl] butanoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 500.54

Molecular Weight (Monoisotopic): 500.2046

AlogP: 4.05

#Rotatable Bonds: 9

Polar Surface Area: 98.75

Molecular Species: NEUTRAL

HBA: 9

HBD: ┄

#RO5 Violations: 1

HBA (Lipinski): 9

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 3.27

CX LogD: 3.27

Aromatic Rings: 2

Heavy Atoms: 36

QED Weighted: 0.47

Np Likeness Score: 1.33

References

1. He S, Shao Y, Fan L, Che Z, Xu H, Zhi X, Wang J, Yao X, Qu H..  (2013)  Synthesis and quantitative structure-activity relationship (QSAR) study of novel 4-acyloxypodophyllotoxin derivatives modified in the A and C rings as insecticidal agents.,  61  (3): [PMID:23278333] [10.1021/jf305011n]

Source

Source(1):

• Scientific Literature