(3aR,4S,9R,9aR)-6,7-dimethoxy-1-oxo-9-(3,4,5-trimethoxyphenyl)-1,3,3a,4,9,9a-hexahydronaphtho[2,3-c]furan-4-yl hexanoate

ID: ALA2288948

PubChem CID: 71541612

Max Phase: Preclinical

Molecular Formula: C29H36O9

Molecular Weight: 528.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCC(=O)O[C@@H]1c2cc(OC)c(OC)cc2[C@@H](c2cc(OC)c(OC)c(OC)c2)[C@H]2C(=O)OC[C@@H]21

Standard InChI:  InChI=1S/C29H36O9/c1-7-8-9-10-24(30)38-27-18-14-21(33-3)20(32-2)13-17(18)25(26-19(27)15-37-29(26)31)16-11-22(34-4)28(36-6)23(12-16)35-5/h11-14,19,25-27H,7-10,15H2,1-6H3/t19-,25+,26-,27+/m0/s1

Standard InChI Key:  JSWYQIBXGBJLJB-DWJNZRAMSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   17.2722  -27.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2704  -26.1127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9790  -26.5179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9778  -27.3431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6879  -27.7545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6903  -26.1041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4049  -26.5200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4017  -27.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1837  -27.6009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6703  -26.9367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1890  -26.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5641  -27.3411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5654  -26.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7892  -26.2710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7872  -27.5922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6903  -25.2869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6869  -28.5717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9796  -28.9771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9783  -29.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6860  -30.2038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3966  -29.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3944  -28.9765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4331  -28.3790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2699  -30.2009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5628  -29.7911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6861  -31.0209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9784  -31.4296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1052  -30.1986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1071  -31.0158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6205  -25.4714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6160  -28.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3981  -24.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3981  -24.0611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1057  -25.2870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6904  -23.6525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6904  -22.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3982  -22.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3982  -21.6096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 12  1  1  0
  1  4  2  0
  3  2  2  0
  2 13  1  0
  3  4  1  0
  3  6  1  0
  4  5  1  0
  5  8  1  0
  7  6  1  0
  7  8  1  0
  8  9  1  6
  9 10  1  0
 10 11  1  0
  7 11  1  1
 12 13  2  0
 13 14  1  0
 15 12  1  0
  6 16  1  1
  5 17  1  6
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  9 23  2  0
 19 24  1  0
 24 25  1  0
 20 26  1  0
 26 27  1  0
 21 28  1  0
 28 29  1  0
 14 30  1  0
 15 31  1  0
 16 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Associated Targets(non-human)

Mythimna separata (3306 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 528.60Molecular Weight (Monoisotopic): 528.2359AlogP: 4.83#Rotatable Bonds: 11
Polar Surface Area: 98.75Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.16CX LogD: 4.16
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.30Np Likeness Score: 1.29

References

1. He S, Shao Y, Fan L, Che Z, Xu H, Zhi X, Wang J, Yao X, Qu H..  (2013)  Synthesis and quantitative structure-activity relationship (QSAR) study of novel 4-acyloxypodophyllotoxin derivatives modified in the A and C rings as insecticidal agents.,  61  (3): [PMID:23278333] [10.1021/jf305011n]

Source