(3aR,4S,9R,9aR)-6,7-dimethoxy-1-oxo-9-(3,4,5-trimethoxyphenyl)-1,3,3a,4,9,9a-hexahydronaphtho[2,3-c]furan-4-yl 2-phenylacetate

ID: ALA2288949

PubChem CID: 71541613

Max Phase: Preclinical

Molecular Formula: C31H32O9

Molecular Weight: 548.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2c(cc1OC)[C@@H](OC(=O)Cc1ccccc1)[C@H]1COC(=O)[C@@H]1[C@@H]2c1cc(OC)c(OC)c(OC)c1

Standard InChI:  InChI=1S/C31H32O9/c1-34-22-14-19-20(15-23(22)35-2)29(40-26(32)11-17-9-7-6-8-10-17)21-16-39-31(33)28(21)27(19)18-12-24(36-3)30(38-5)25(13-18)37-4/h6-10,12-15,21,27-29H,11,16H2,1-5H3/t21-,27+,28-,29+/m0/s1

Standard InChI Key:  MNNWQAHBHHWJQT-MHTDFPPDSA-N

Molfile:  

     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   23.1906  -26.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1888  -25.0190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8975  -25.4242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8963  -26.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6064  -26.6607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6087  -25.0104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3234  -25.4263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3201  -26.2496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1021  -26.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5888  -25.8429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1074  -25.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4826  -26.2474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4838  -25.4308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7076  -25.1773    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7056  -26.4984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6088  -24.1932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6054  -27.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8980  -27.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8967  -28.6998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6045  -29.1100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3150  -28.6979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3128  -27.8828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3516  -27.2853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.1883  -29.1072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.4813  -28.6974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6046  -29.9272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8969  -30.3359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0237  -29.1049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0256  -29.9221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5389  -24.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5345  -27.2975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3165  -23.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3165  -22.9674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0242  -24.1932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0243  -22.5589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7274  -22.9704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4346  -22.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4351  -21.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7224  -21.3360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0181  -21.7463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 12  1  1  0
  1  4  2  0
  3  2  2  0
  2 13  1  0
  3  4  1  0
  3  6  1  0
  4  5  1  0
  5  8  1  0
  7  6  1  0
  7  8  1  0
  8  9  1  6
  9 10  1  0
 10 11  1  0
  7 11  1  1
 12 13  2  0
 13 14  1  0
 15 12  1  0
  6 16  1  1
  5 17  1  6
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  9 23  2  0
 19 24  1  0
 24 25  1  0
 20 26  1  0
 26 27  1  0
 21 28  1  0
 28 29  1  0
 14 30  1  0
 15 31  1  0
 16 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 35  1  0
M  END

Associated Targets(non-human)

Mythimna separata (3306 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 548.59Molecular Weight (Monoisotopic): 548.2046AlogP: 4.49#Rotatable Bonds: 9
Polar Surface Area: 98.75Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 3.96CX LogD: 3.96
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.36Np Likeness Score: 1.05

References

1. He S, Shao Y, Fan L, Che Z, Xu H, Zhi X, Wang J, Yao X, Qu H..  (2013)  Synthesis and quantitative structure-activity relationship (QSAR) study of novel 4-acyloxypodophyllotoxin derivatives modified in the A and C rings as insecticidal agents.,  61  (3): [PMID:23278333] [10.1021/jf305011n]

Source