The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-ylcarbamothioyl)-2-(4-nitrophenoxy)acetamide ID: ALA2288969
PubChem CID: 14690721
Max Phase: Preclinical
Molecular Formula: C18H15N5O6S
Molecular Weight: 429.41
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2nnc(NC(=S)NC(=O)COc3ccc([N+](=O)[O-])cc3)o2)cc1
Standard InChI: InChI=1S/C18H15N5O6S/c1-27-13-6-2-11(3-7-13)16-21-22-17(29-16)20-18(30)19-15(24)10-28-14-8-4-12(5-9-14)23(25)26/h2-9H,10H2,1H3,(H2,19,20,22,24,30)
Standard InChI Key: BTSMWWASFKZGAU-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
22.4589 -8.2445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7437 -7.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0345 -8.2512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0393 -9.0746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7592 -9.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4654 -9.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1840 -9.4698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1915 -10.2952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9100 -10.7013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9175 -11.5267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6211 -10.2822 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3396 -10.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0506 -10.2692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3471 -11.5137 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
26.7691 -10.6754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8666 -11.4925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6754 -11.6568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0816 -10.9382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5237 -10.3299 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0175 -12.4051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5367 -13.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8786 -13.8278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7011 -13.9071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1805 -13.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8359 -12.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3133 -7.8432 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6008 -8.2602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3084 -7.0178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0446 -14.6576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5665 -15.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 15 2 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
17 20 1 0
26 27 2 0
26 28 1 0
3 26 1 0
23 29 1 0
29 30 1 0
M CHG 2 26 1 28 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.41Molecular Weight (Monoisotopic): 429.0743AlogP: 2.55#Rotatable Bonds: 7Polar Surface Area: 141.65Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.97CX Basic pKa: ┄CX LogP: 2.75CX LogD: 2.73Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.33Np Likeness Score: -2.03
References 1. MISHRA B, NIZAMUDDIN. (1990) Synthesis and Fungicidal Activities of Some 1-Aryloxyaceto-3-(5-aryl-1, 3, 4-oxadiazol-2-yl) thioureas and Corresponding Oxadiazolo [3, 2-a]-s-triazines, 15 (3): [10.1584/jpestics.15.353 ]