The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,4-dichlorophenoxy)-N-(5-((2,4-dichlorophenoxy)methyl)-1,3,4-thiadiazol-2-ylcarbamothioyl)acetamide ID: ALA2288981
PubChem CID: 76327471
Max Phase: Preclinical
Molecular Formula: C18H12Cl4N4O3S2
Molecular Weight: 538.27
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(COc1ccc(Cl)cc1Cl)NC(=S)Nc1nnc(COc2ccc(Cl)cc2Cl)s1
Standard InChI: InChI=1S/C18H12Cl4N4O3S2/c19-9-1-3-13(11(21)5-9)28-7-15(27)23-17(30)24-18-26-25-16(31-18)8-29-14-4-2-10(20)6-12(14)22/h1-6H,7-8H2,(H2,23,24,26,27,30)
Standard InChI Key: OUVCTFQOSGKNOZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
5.4798 -17.0757 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.1460 -16.5883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8882 -15.8041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0627 -15.8068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8111 -16.5924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9308 -16.8411 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0917 -16.9965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3820 -16.5755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6628 -16.9797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9547 -16.5585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2358 -16.9619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2257 -17.7878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9404 -18.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6563 -17.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5099 -18.1928 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.6621 -16.4591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3586 -16.9013 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6969 -15.6347 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.0899 -16.5194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7864 -16.9616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1248 -15.6950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9652 -15.7335 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.7517 -17.7860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4481 -18.2283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4094 -19.0521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1050 -19.4942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8373 -19.1122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8696 -18.2835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1732 -17.8450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2044 -17.0205 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.5344 -19.5536 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
2 6 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
6 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
19 20 1 0
19 21 2 0
10 22 1 0
20 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
29 30 1 0
27 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.27Molecular Weight (Monoisotopic): 535.9105AlogP: 5.62#Rotatable Bonds: 7Polar Surface Area: 85.37Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.99CX Basic pKa: ┄CX LogP: 5.79CX LogD: 5.78Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.38Np Likeness Score: -2.17
References 1. TIWARI N, DWIVEDI B, NIZAMUDDIN. (1990) Synthesis of Some 2-Aryloxymethyl-1, 3, 4-thiadiazolo[2, 3-b]-quinazolin-4-ones and 2-Aryloxymethyl-5-substituted-1, 3, 4-thiadiazolo[3, 2-a]-s-triazin-7-thiones as Potential Biocides, 15 (3): [10.1584/jpestics.15.357 ]