The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl 5-(N-(4,6-dimethoxypyrimidin-2-ylcarbamoyl)sulfamoyl)-1,3-dimethyl-1H-pyrazole-4-carboxylate ID: ALA2289016
PubChem CID: 13453974
Max Phase: Preclinical
Molecular Formula: C15H20N6O7S
Molecular Weight: 428.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1c(C)nn(C)c1S(=O)(=O)NC(=O)Nc1nc(OC)cc(OC)n1
Standard InChI: InChI=1S/C15H20N6O7S/c1-6-28-13(22)11-8(2)19-21(3)12(11)29(24,25)20-15(23)18-14-16-9(26-4)7-10(17-14)27-5/h7H,6H2,1-5H3,(H2,16,17,18,20,23)
Standard InChI Key: DOMUIFJSLSRVGI-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
12.9657 -16.3056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9845 -17.1258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7713 -17.3605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2366 -16.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7348 -16.0334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1341 -15.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0616 -16.6845 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.4734 -17.3994 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2984 -17.4002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7102 -18.1150 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7116 -16.6861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5352 -18.1157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9441 -18.8311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7684 -18.8322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1824 -18.1176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7661 -17.4004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9432 -17.4028 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0543 -15.8585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7710 -16.2668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1768 -16.6848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0018 -16.6827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1798 -19.5473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7663 -20.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0459 -18.1385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9589 -15.2961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7084 -14.6047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2866 -15.8371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3581 -14.5742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1830 -14.5588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
1 2 2 0
3 4 1 0
4 5 2 0
5 1 1 0
5 6 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
7 18 2 0
7 19 2 0
16 20 1 0
20 21 1 0
14 22 1 0
22 23 1 0
3 24 1 0
6 25 1 0
6 26 2 0
1 27 1 0
25 28 1 0
28 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.43Molecular Weight (Monoisotopic): 428.1114AlogP: 0.22#Rotatable Bonds: 7Polar Surface Area: 163.63Molecular Species: ACIDHBA: 11HBD: 2#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.04CX Basic pKa: 2.69CX LogP: 1.11CX LogD: 0.18Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.58Np Likeness Score: -1.35
References 1. YAMAMOTO S, SATO T, IWASAWA Y, SUZUKI F, IKAI T, SUZUKI K, NAWAMAKI T. (1990) Selective Herbicidal Activities of Ethyl 5-(4, 6-Dimethoxypyrimidin-2-ylcarbamoylsulfamoyl)-1-methylpyrazole-4-carboxylate and Its Related Compounds, 15 (4): [10.1584/jpestics.15.531 ]