4-Chlorophenyl 4-(3-(2,6-Difluorobenzoyl)ureido)-benzenesulfonate

ID: ALA2289191

PubChem CID: 71540992

Max Phase: Preclinical

Molecular Formula: C20H13ClF2N2O5S

Molecular Weight: 466.85

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NC(=O)c1c(F)cccc1F)Nc1ccc(S(=O)(=O)Oc2ccc(Cl)cc2)cc1

Standard InChI:  InChI=1S/C20H13ClF2N2O5S/c21-12-4-8-14(9-5-12)30-31(28,29)15-10-6-13(7-11-15)24-20(27)25-19(26)18-16(22)2-1-3-17(18)23/h1-11H,(H2,24,25,26,27)

Standard InChI Key:  NPTZRWYQXBBHST-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    7.5198  -12.8893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5239  -13.7065    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.2296  -13.2944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5860  -12.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4014  -12.9951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8083  -12.2906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4010  -11.5845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5824  -11.5873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1792  -12.2924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8084  -10.8762    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.8095  -13.7031    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.6255  -12.2908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0340  -12.9986    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0343  -11.5832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8511  -12.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2596  -13.7066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2599  -12.2912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0768  -13.7068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4830  -14.4168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2994  -14.4174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7090  -13.7092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2962  -12.9991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4811  -13.0020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9355  -14.4156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7527  -14.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1600  -15.1216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9764  -15.1211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3851  -14.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9713  -13.7028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1562  -13.7068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2023  -14.4104    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  7 10  1  0
  5 11  1  0
  6 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21  2  1  0
  2 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
M  END

Associated Targets(non-human)

Plutella xylostella (1838 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mythimna separata (3306 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 466.85Molecular Weight (Monoisotopic): 466.0202AlogP: 4.35#Rotatable Bonds: 5
Polar Surface Area: 101.57Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.04CX Basic pKa: CX LogP: 4.83CX LogD: 4.82
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.54Np Likeness Score: -1.61

References

1. Sun R, Wang Z, Li Y, Xiong L, Liu Y, Wang Q..  (2013)  Design, synthesis, and insecticidal evaluation of new benzoylureas containing amide and sulfonate groups based on the sulfonylurea receptor protein binding site for diflubenzuron and glibenclamide.,  61  (3): [PMID:23305601] [10.1021/jf304468b]

Source