The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4,6-dimethoxypyrimidin-2-yloxy)-6-(2-ethoxyethoxy)benzoic acid ID: ALA2289312
PubChem CID: 14678394
Max Phase: Preclinical
Molecular Formula: C17H20N2O7
Molecular Weight: 364.35
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOCCOc1cccc(Oc2nc(OC)cc(OC)n2)c1C(=O)O
Standard InChI: InChI=1S/C17H20N2O7/c1-4-24-8-9-25-11-6-5-7-12(15(11)16(20)21)26-17-18-13(22-2)10-14(19-17)23-3/h5-7,10H,4,8-9H2,1-3H3,(H,20,21)
Standard InChI Key: YEMJHWXICZCXCO-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 27 0 0 0 0 0 0 0 0999 V2000
24.7042 -5.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7030 -5.9992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4111 -6.4081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1207 -5.9987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1179 -5.1760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4093 -4.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8291 -6.4062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8304 -7.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1220 -7.6315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1229 -8.4479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8318 -8.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5412 -8.4421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5368 -7.6271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4157 -8.8573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.7075 -8.4495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2510 -8.8471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.2552 -9.6643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8256 -4.7645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5348 -5.1705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8225 -3.9473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4068 -3.9536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6979 -3.5471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6955 -2.7345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9865 -2.3281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9841 -1.5185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2752 -1.1078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
10 14 1 0
14 15 1 0
12 16 1 0
16 17 1 0
18 19 1 0
18 20 2 0
5 18 1 0
6 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 364.35Molecular Weight (Monoisotopic): 364.1271AlogP: 2.40#Rotatable Bonds: 10Polar Surface Area: 109.23Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.15CX Basic pKa: 0.03CX LogP: 2.91CX LogD: -0.54Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.64Np Likeness Score: -0.67
References 1. NEZU Y, WADA N, SAITOH Y, TAKAHASHI S, MIYAZAWA T. (1996) Synthesis and Herbicidal Activity of Pyrimidinyl Salicylic and Thiosalicylic Acids, 21 (3): [10.1584/jpestics.21.293 ]